PPIRE11244
Target Protein Information
| Protein_Name | Centrosomal protein of 55 kDa |
|---|---|
| Protein_Sequence | MSSRSTKDLIKSKWGSKPSNSKSETTLEKLKGEIAHLKTSVDEITSGKGKLTDKERHRLLEKIRVLEAEKEKNAYQLTEKDKEIQRLRDQLKARYSTTTLLEQLEETTREGERREQVLKALSEEKDVLKQQLSAATSRIAELESKTNTLRLSQTVAPNCFNSSINNIHEMEIQLKDALEKNQQWLVYDQQREVYVKGLLAKIFELEKKTETAAHSLPQQTKKPESEGYLQEEKQKCYNDLLASAKKDLEVERQTITQLSFELSEFRRKYEETQKEVHNLNQLLYSQRRADVQHLEDDRHKTEKIQKLREENDIARGKLEEEKKRSEELLSQVQFLYTSLLKQQEEQTRVALLEQQMQACTLDFENEKLDRQHVQHQLHVILKELRKARNQITQLESLKQLHEFAITEPLVTFQGETENREKVAASPKSPTAALNESLVECPKCNIQYPATEHRDLLVHVEYCSK |
| Organism_Source | Homo sapiens |
| Functional_Classification | coiled-coil proteins |
| Cellular_Localization | Cytoplasm |
| Gene_Names | CEP55 |
| UniProt_ID | Q53EZ4 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | TEX14_792-804 |
|---|---|
| Peptide_Sequence | XAXGPPXXXYIPP |
| Peptide_Length | 13 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)CNC(=O)CNC(=O)CNC(=O)[C@@H]1CCCN1C(=O)[C@@H]1CCCN1C(=O)CNC(=O)CNC(=O)[C@H](C)NC(=O)CN)C(=O)N1CCC[C@H]1C(=O)N1CCC[C@H]1C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1096.21 |
|---|---|
| Aliphatic_Index | 37.69231 |
| Aromaticity | 0.07692 |
| Average_Rotatable_Bonds | 1.92308 |
| Charge_at_pH_7 | -0.00287 |
| Isoelectric_Point | 6.09320 |
|---|---|
| Hydrogen_Bond_Acceptors | 15 |
| Hydrogen_Bond_Donors | 11 |
| Topological_Polar_Surface_Area | 397.59000 |
| X_logP_energy | -4.95660 |
Interaction Information
| Affinity | KD=300 nM |
|---|---|
| Affinity_Assay | Surface plasmon resonance |
| PDB_ID | 3WUT |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Structural and biochemical insights into the role of testis-expressed gene 14 (TEX14)in forming the stable intercellular bridges of germ cells. |
| Release_Year | 2015 |
| PMID | 26392564 |
| DOI | 10.1073/pnas.1418606112 |