PPIRE11311
Target Protein Information
| Protein_Name | Neuronal acetylcholine receptor subunit alpha-9 |
|---|---|
| Protein_Sequence | MNWSHSCISFCWIYFAASRLRAAETADGKYAQKLFNDLFEDYSNALRPVEDTDKVLNVTLQITLSQIKDMDERNQILTAYLWIRQIWHDAYLTWDRDQYDGLDSIRIPSDLVWRPDIVLYNKADDESSEPVNTNVVLRYDGLITWDAPAITKSSCVVDVTYFPFDNQQCNLTFGSWTYNGNQVDIFNALDSGDLSDFIEDVEWEVHGMPAVKNVISYGCCSEPYPDVTFTLLLKRRSSFYIVNLLIPCVLISFLAPLSFYLPAASGEKVSLGVTILLAMTVFQLMVAEIMPASENVPLIGKYYIATMALITASTALTIMVMNIHFCGAEARPVPHWARVVILKYMSRVLFVYDVGESCLSPHHSRERDHLTKVYSKLPESNLKAARNKDLSRKKDMNKRLKNDLGCQGKNPQEAESYCAQYKVLTRNIEYIAKCLKDHKATNSKGSEWKKVAKVIDRFFMWIFFIMVFVMTILIIARAD |
| Organism_Source | Homo sapiens |
| Functional_Classification | ligand-gated ion channels |
| Cellular_Localization | Plasma membrane |
| Gene_Names | CHRNA9 |
| UniProt_ID | Q9UGM1 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | alpha-conotoxin RgIA |
|---|---|
| Peptide_Sequence | GCCSDPRCRYRCR |
| Peptide_Length | 13 |
| Peptide_SMILES | N=C(N)NCCC[C@H](NC(=O)[C@H](CS)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CS)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CC(=O)O)NC(=O)[C@H](CO)NC(=O)[C@H](CS)NC(=O)[C@H](CS)NC(=O)CN)C(=O)O |
| Chemical_Modification | |
| Cyclization_Method | Side chain-side chain cyclization; C1<->C3; disulfide bond; C2<->C4; disulfide bond |
| Linear/Cyclic | Cyclic |
| N-terminal_Modification | Free |
| C-terminal_Modification | amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1574.83 |
|---|---|
| Aliphatic_Index | 0.00000 |
| Aromaticity | 0.07692 |
| Average_Rotatable_Bonds | 3.76923 |
| Charge_at_pH_7 | 2.74967 |
| Isoelectric_Point | 8.68288 |
|---|---|
| Hydrogen_Bond_Acceptors | 25 |
| Hydrogen_Bond_Donors | 32 |
| Topological_Polar_Surface_Area | 729.09000 |
| X_logP_energy | -10.45892 |
Interaction Information
| Affinity | Ki=2.7 uM |
|---|---|
| Affinity_Assay | radioligand competition binding assay |
| PDB_ID | 6HY7 |
| Type | Ion channel modulator |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Crystal Structure of the Monomeric Extracellular Domain of Alpha9 Nicotinic Receptor Subunit in Complex With Alpha-Conotoxin RgIA: Molecular Dynamics Insights Into RgIA Binding to Alpha9Alpha10 Nicotinic Receptors. |
| Release_Year | 2019 |
| PMID | 31118896 |
| DOI | 10.3389/fphar.2019.00474 |