PPIRE11385
Target Protein Information
| Protein_Name | None |
|---|---|
| Protein_Sequence | SSSGSTGEIYAAREKTERAERETIQGGDRGLTAPRAEGDTIQGATNRGLAAPQFSLWKRPVVTAYIEGQPVEVLLDTGADDSIVAGIELGNNYSPKIVGGIGGFINTKEYKNVEIEVLNKKVRATIMTGDTPINIFGRNILTALGMSLNL |
| Organism_Source | Human immunodeficiency virus 2 |
| Functional_Classification | proteases |
| Cellular_Localization | Cytoplasm |
| Gene_Names | pol |
| UniProt_ID | Q90066 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | AbF1 |
|---|---|
| Peptide_Sequence | XTLNFGGGXTLNF |
| Peptide_Length | 13 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)[C@@H](NC(=O)CNC(=O)CNC(=O)CNC(=O)CNC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)CN)[C@@H](C)O)[C@@H](C)O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| Chemical_Modification | X1=aminobutyric acid; X9=aminobutyric acid |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1254.36 |
|---|---|
| Aliphatic_Index | 60.00000 |
| Aromaticity | 0.15385 |
| Average_Rotatable_Bonds | 3.00000 |
| Charge_at_pH_7 | -0.00202 |
| Isoelectric_Point | 6.10000 |
|---|---|
| Hydrogen_Bond_Acceptors | 18 |
| Hydrogen_Bond_Donors | 18 |
| Topological_Polar_Surface_Area | 539.16000 |
| X_logP_energy | -7.53710 |
Interaction Information
| Affinity | IC50=200 uM |
|---|---|
| Affinity_Assay | Enzyme Inhibition Kinetics |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Antigen-antibody interactions: elucidation of the epitope and strain-specificity of a monoclonal antibody directed against the pilin protein adherence binding domain of Pseudomonas aeruginosa strain K. |
| Release_Year | 1992 |
| PMID | 1284654 |
| DOI | 10.1002/pro.5560011010 |