PPIRE11386
Target Protein Information
| Protein_Name | Tumor necrosis factor ligand superfamily member 13B |
|---|---|
| Protein_Sequence | MDDSTEREQSRLTSCLKKREEMKLKECVSILPRKESPSVRSSKDGKLLAATLLLALLSCCLTVVSFYQVAALQGDLASLRAELQGHHAEKLPAGAGAPKAGLEEAPAVTAGLKIFEPPAPGEGNSSQNSRNKRAVQGPEETVTQDCLQLIADSETPTIQKGSYTFVPWLLSFKRGSALEEKENKILVKETGYFFIYGQVLYTDKTYAMGHLIQRKKVHVFGDELSLVTLFRCIQNMPETLPNNSCYSAGIAKLEEGDELQLAIPRENAQISLDGDVTFFGALKLL |
| Organism_Source | Homo sapiens |
| Functional_Classification | TNF family |
| Cellular_Localization | Extracellular |
| Gene_Names | TNFSF13B |
| UniProt_ID | Q9Y275 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | DX-817 |
|---|---|
| Peptide_Sequence | ANWFDPLTKLWLPD |
| Peptide_Length | 14 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)[C@H](CCCCN)NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](C)N)[C@@H](C)O)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](CC(C)C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CC(=O)O)C(=O)O |
| Chemical_Modification | |
| Cyclization_Method | |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Acetyl |
| C-terminal_Modification | amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1715.97 |
|---|---|
| Aliphatic_Index | 90.71429 |
| Aromaticity | 0.21429 |
| Average_Rotatable_Bonds | 3.42857 |
| Charge_at_pH_7 | -1.00142 |
| Isoelectric_Point | 4.10925 |
|---|---|
| Hydrogen_Bond_Acceptors | 20 |
| Hydrogen_Bond_Donors | 20 |
| Topological_Polar_Surface_Area | 619.56000 |
| X_logP_energy | -1.10340 |
Interaction Information
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Discovery of high-affinity peptide binders to BLyS by phage display. |
| Release_Year | 2005 |
| PMID | 15382264 |
| DOI | 10.1002/jmr.722 |