PPIRE11527
Target Protein Information
| Protein_Name | Proteasomal ubiquitin receptor ADRM1 |
|---|---|
| Protein_Sequence | MTTSGALFPSLVPGSRGASNKYLVEFRAGKMSLKGTTVTPDKRKGLVYIQQTDDSLIHFCWKDRTSGNVEDDLIIFPDDCEFKRVPQCPSGRVYVLKFKAGSKRLFFWMQEPKTDQDEEHCRKVNEYLNNPPMPGALGASGSSGHELSALGGEGGLQSLLGNMSHSQLMQLIGPAGLGGLGGLGALTGPGLASLLGSSGPPGSSSSSSSRSQSAAVTPSSTTSSTRATPAPSAPAAASATSPSPAPSSGNGASTAASPTQPIQLSDLQSILATMNVPAGPAGGQQVDLASVLTPEIMAPILANADVQERLLPYLPSGESLPQTADEIQNTLTSPQFQQALGMFSAALASGQLGPLMCQFGLPAEAVEAANKGDVEAFAKAMQNNAKPEQKEGDTKDKKDEEEDMSLD |
| Organism_Source | Homo sapiens |
| Functional_Classification | ubiquitin receptors |
| Cellular_Localization | Cytoplasm |
| Gene_Names | ADRM1 |
| UniProt_ID | Q16186 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | RPN2_P942A |
|---|---|
| Peptide_Sequence | PQEAEPPEPFEYID |
| Peptide_Length | 14 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CCC(=O)O)NC(=O)[C@@H]1CCCN1C(=O)[C@@H]1CCCN1C(=O)[C@H](CCC(=O)O)NC(=O)[C@H](C)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H]1CCCN1)C(=O)N[C@@H](CC(=O)O)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | fluorescein |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1660.75 |
|---|---|
| Aliphatic_Index | 35.00000 |
| Aromaticity | 0.14286 |
| Average_Rotatable_Bonds | 3.35714 |
| Charge_at_pH_7 | -4.99532 |
| Isoelectric_Point | 3.25717 |
|---|---|
| Hydrogen_Bond_Acceptors | 22 |
| Hydrogen_Bond_Donors | 19 |
| Topological_Polar_Surface_Area | 651.08000 |
| X_logP_energy | -3.89960 |
Interaction Information
| Affinity | Ki=48 nM |
|---|---|
| Affinity_Assay | Fluorescence Polarization |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Structure and energetics of pairwise interactions between proteasome subunits RPN2, RPN13, and ubiquitin clarify a substrate recruitment mechanism. |
| Release_Year | 2017 |
| PMID | 28442575 |
| DOI | 10.1074/jbc.M117.785287 |