PPIRE11815
Target Protein Information
| Protein_Name | Neuropeptide Y receptor type 2 |
|---|---|
| Protein_Sequence | MGPLGAEADENQTVEVKVELYGSGPTTPRGELPPDPEPELIDSTKLVEVQVVLILAYCSIILLGVVGNSLVIHVVIKFKSMRTVTNFFIANLAVADLLVNTLCLPFTLTYTLMGEWKMGPVLCHLVPYAQGLAVQVSTITLTVIALDRHRCIVYHLESKISKQISFLIIGLAWGVSALLASPLAIFREYSLIEIIPDFEIVACTEKWPGEEKSVYGTVYSLSTLLILYVLPLGIISFSYTRIWSKLKNHVSPGAASDHYHQRRHKTTKMLVCVVVVFAVSWLPLHAFQLAVDIDSHVLDLKEYKLIFTVFHIIAMCSTFANPLLYGWMNSNYRKAFLSAFRCEQRLDAIHSEVSMTFKAKKNLEVKKNNGLTDSFSEATNV |
| Organism_Source | Rattus norvegicus |
| Functional_Classification | G protein-coupled receptor |
| Cellular_Localization | Plasma membrane |
| Gene_Names | Npy2r |
| UniProt_ID | Q9ERC0 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | N-R-Ac-[Dip27]PYY(22-36)-NH2 |
|---|---|
| Peptide_Sequence | ASLRHXLNLVTRQRY |
| Peptide_Length | 15 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)CNC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@H](C)N)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O)[C@@H](C)O)C(C)C |
| Chemical_Modification | X6=Dip |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Acetyl |
| C-terminal_Modification | amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1784.05 |
|---|---|
| Aliphatic_Index | 104.00000 |
| Aromaticity | 0.06667 |
| Average_Rotatable_Bonds | 3.93333 |
| Charge_at_pH_7 | 3.08803 |
| Isoelectric_Point | 12.20421 |
|---|---|
| Hydrogen_Bond_Acceptors | 25 |
| Hydrogen_Bond_Donors | 31 |
| Topological_Polar_Surface_Area | 831.97000 |
| X_logP_energy | -9.15099 |
Interaction Information
| Affinity | IC50=16.5 nM |
|---|---|
| Affinity_Assay | radioligand binding assay |
| PDB_ID | None |
| Type | Agonist |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Structure-activity studies including a Psi(CH(2)-NH)scan of peptide YY (PYY)active site, PYY(22-36), for interaction with rat intestinal PYY receptors: development of analogues with potent in vivo activity in the intestine. |
| Release_Year | 2000 |
| PMID | 10978189 |
| DOI | 10.1021/jm000052z |