PPIRE12114
Target Protein Information
| Protein_Name | Karilysin |
|---|---|
| Protein_Sequence | MKRFILLFFLSTIAIFKVYSQRLYDNGPLTGDNNYVLQGSKWNKTTLKYYIYNSSSHLTTTERENAIRSAFALWSDKSTLSFIQVYNPNQADIKIKWEKGNHGDGYPFDGNTGILAHAFYPPPAGGNYAGHLHFDGDENWSINGSGIDLITVAAHEIGHLLGIEHSNVSSALMYPYYTGIKRQLDNDDCLAVWDLYGYPFSISGPSSVCDQATYTVENLLSGATVQWSVSNPNIATINSSNGVLTCRGNGICEVRATINNSSVALTPLKICLGTPISQDITLTVESLNSNGTLCTDNPNAIMADHPGGNHLGYIREYEWRISNGWQIAHHPGDNGIYADHFIVTVIPLSPLPGSPTVSVRARSECGWGTWKEVQIPAVSCSRTISPFTLSPNPATDEVILQLMETDEVSGLSVLSTDRSAYEIQIWSGMRMLRSFRTNEPTFQISMTGLPAGLYFVRVVKNGQTYTQKLIKK |
| Organism_Source | Tannerella forsythia (strain ATCC 43037 / JCM 10827 / CCUG 21028 A / KCTC 5666 / FDC 338) |
| Functional_Classification | metallopeptidases |
| Cellular_Localization | Extracellular |
| Gene_Names | kly |
| UniProt_ID | D0EM77 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | SWFP |
|---|---|
| Peptide_Sequence | SWFP |
| Peptide_Length | 4 |
| Peptide_SMILES | N[C@@H](CO)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](Cc1ccccc1)C(=O)N1CCC[C@H]1C(=O)O |
| Chemical_Modification | |
| Cyclization_Method | |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 535.60 |
|---|---|
| Aliphatic_Index | 0.00000 |
| Aromaticity | 0.50000 |
| Average_Rotatable_Bonds | 2.75000 |
| Charge_at_pH_7 | -0.00202 |
| Isoelectric_Point | 6.10000 |
|---|---|
| Hydrogen_Bond_Acceptors | 6 |
| Hydrogen_Bond_Donors | 6 |
| Topological_Polar_Surface_Area | 177.85000 |
| X_logP_energy | 0.31790 |
Interaction Information
| Affinity | Ki=10.7 mM |
|---|---|
| Affinity_Assay | Enzyme Inhibition Kinetics |
| PDB_ID | 4IN9 |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Structure of the catalytic domain of the Tannerella forsythia matrix metallopeptidase karilysin in complex with a tetrapeptidic inhibitor. |
| Release_Year | 2013 |
| PMID | 23695557 |
| DOI | 10.1107/S1744309113007392 |