PPIRE12153
Target Protein Information
| Protein_Name | Kappa-6-bungarotoxin |
|---|---|
| Protein_Sequence | MKTLLLSLVVVTIVCLDLGYTRTCHISTSSTPQTCPKGQDICFRKTQCDKFCSIRGAVIEQGCVATCPEFRSNYRSLLCCRTDNCNP |
| Organism_Source | Bungarus multicinctus |
| Functional_Classification | a-neurotoxin |
| Cellular_Localization | Extracellular |
| Gene_Names | None |
| UniProt_ID | Q9W729 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | a18-mer |
|---|---|
| Peptide_Sequence | YRGWKHWVYYTCCPDTPY |
| Peptide_Length | 18 |
| Peptide_SMILES | CC(C)[C@H](NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H](CCCCN)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)CNC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@H](C(=O)N[C@@H](CS)C(=O)N[C@@H](CS)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O)[C@@H](C)O)[C@@H](C)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | homoserine lactone |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 2338.64 |
|---|---|
| Aliphatic_Index | 16.11111 |
| Aromaticity | 0.33333 |
| Average_Rotatable_Bonds | 3.44444 |
| Charge_at_pH_7 | 0.96169 |
| Isoelectric_Point | 8.20895 |
|---|---|
| Hydrogen_Bond_Acceptors | 31 |
| Hydrogen_Bond_Donors | 33 |
| Topological_Polar_Surface_Area | 847.30000 |
| X_logP_energy | -3.36513 |
Interaction Information
| Affinity | KD=65 nM |
|---|---|
| Affinity_Assay | equilibrium binding assay |
| PDB_ID | 1IDG |
| Type | Ion channel modulator |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | The solution structure of the complex formed between alpha-bungarotoxin and an 18-mer cognate peptide derived from the alpha 1 subunit of the nicotinic acetylcholine receptor from Torpedo californica. |
| Release_Year | 2001 |
| PMID | 11312275 |
| DOI | 10.1074/jbc.M102300200 |