PPIRE12458
Target Protein Information
| Protein_Name | Eotaxin |
|---|---|
| Protein_Sequence | MKVSAALLWLLLIAAAFSPQGLAGPASVPTTCCFNLANRKIPLQRLESYRRITSGKCPQKAVIFKTKLAKDICADPKKKWVQDSMKYLDQKSPTPKP |
| Organism_Source | Homo sapiens |
| Functional_Classification | chemokines |
| Cellular_Localization | Extracellular |
| Gene_Names | CCL11 |
| UniProt_ID | P51671 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | CCR3_8-23_peptide |
|---|---|
| Peptide_Sequence | VETFGTTSYYDDVGLL |
| Peptide_Length | 16 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)[C@H](CC(C)C)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](N)C(C)C)[C@@H](C)O)[C@@H](C)O)[C@@H](C)O)C(C)C)C(=O)O |
| Chemical_Modification | Y9=sulfotyrosine; Y10=sulfotyrosine |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1779.92 |
|---|---|
| Aliphatic_Index | 85.00000 |
| Aromaticity | 0.18750 |
| Average_Rotatable_Bonds | 3.37500 |
| Charge_at_pH_7 | -3.00105 |
| Isoelectric_Point | 3.38003 |
|---|---|
| Hydrogen_Bond_Acceptors | 26 |
| Hydrogen_Bond_Donors | 26 |
| Topological_Polar_Surface_Area | 733.10000 |
| X_logP_energy | -6.57450 |
Interaction Information
| Affinity | KD=1 mM |
|---|---|
| Affinity_Assay | NMR chemical shift perturbation |
| PDB_ID | 2MPM |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Structural basis of receptor sulfotyrosine recognition by a CC chemokine: the N-terminal region of CCR3 bound to CCL11/eotaxin-1. |
| Release_Year | 2014 |
| PMID | 25450766 |
| DOI | 10.1016/j.str.2014.08.023 |