PPIRE12534
Target Protein Information
| Protein_Name | Transcriptional enhancer factor TEF-1 |
|---|---|
| Protein_Sequence | MEPSSWSGSESPAENMERMSDSADKPIDNDAEGVWSPDIEQSFQEALAIYPPCGRRKIILSDEGKMYGRNELIARYIKLRTGKTRTRKQVSSHIQVLARRKSRDFHSKLKDQTAKDKALQHMAAMSSAQIVSATAIHNKLGLPGIPRPTFPGAPGFWPGMIQTGQPGSSQDVKPFVQQAYPIQPAVTAPIPGFEPASAPAPSVPAWQGRSIGTTKLRLVEFSAFLEQQRDPDSYNKHLFVHIGHANHSYSDPLLESVDIRQIYDKFPEKKGGLKELFGKGPQNAFFLVKFWADLNCNIQDDAGAFYGVTSQYESSENMTVTCSTKVCSFGKQVVEKVETEYARFENGRFVYRINRSPMCEYMINFIHKLKHLPEKYMMNSVLENFTILLVVTNRDTQETLLCMACVFEVSNSEHGAQHHIYRLVKD |
| Organism_Source | Homo sapiens |
| Functional_Classification | TEA domain transcription factor |
| Cellular_Localization | Nucleus |
| Gene_Names | TEAD1 |
| UniProt_ID | P28347 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | Peptide 17 |
|---|---|
| Peptide_Sequence | VPXXLRKXPSFCKPPE |
| Peptide_Length | 16 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)CNC(=O)CNC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)C(C)C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCCCN)C(=O)NCC(=O)N1CCC[C@H]1C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CS)C(=O)N[C@@H](CCCCN)C(=O)N1CCC[C@H]1C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCC(=O)O)C(=O)O |
| Chemical_Modification | X3=3-chlorophenylalanine; X4=homocysteine; X8=norleucine |
| Cyclization_Method | side chain-side chain cyclization; X4<->C13; disulfide bond |
| Linear/Cyclic | Cyclic |
| N-terminal_Modification | Acetyl |
| C-terminal_Modification | amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1668.97 |
|---|---|
| Aliphatic_Index | 42.50000 |
| Aromaticity | 0.06250 |
| Average_Rotatable_Bonds | 3.06250 |
| Charge_at_pH_7 | 1.93719 |
| Isoelectric_Point | 9.67375 |
|---|---|
| Hydrogen_Bond_Acceptors | 23 |
| Hydrogen_Bond_Donors | 21 |
| Topological_Polar_Surface_Area | 636.13000 |
| X_logP_energy | -6.15773 |
Interaction Information
| Affinity | KD=0.025 uM |
|---|---|
| Affinity_Assay | Surface plasmon resonance |
| PDB_ID | 3KYS |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Structure-Based Design and Synthesis of Potent Cyclic Peptides Inhibiting the YAP-TEAD Protein-Protein Interaction. |
| Release_Year | 2014 |
| PMID | 25221655 |
| DOI | 10.1021/ml500160m |