PPIRE12647
Target Protein Information
| Protein_Name | Interleukin-8 |
|---|---|
| Protein_Sequence | MTSKLAVALLAAFLISAALCEGAVLPRSAKELRCQCIKTYSKPFHPKFIKELRVIESGPHCANTEIIVKLSDGRELCLDPKENWVQRVVEKFLKRAENS |
| Organism_Source | Homo sapiens |
| Functional_Classification | CXC chemokine |
| Cellular_Localization | Extracellular |
| Gene_Names | CXCL8 |
| UniProt_ID | P10145 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | CXCR1-p1 |
|---|---|
| Peptide_Sequence | MEAADEXLPSDLQEVRP |
| Peptide_Length | 17 |
| Peptide_SMILES | CSCC[C@H](N)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](C)C(=O)N[C@@H](C)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CO)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)O)C(C)C |
| Chemical_Modification | X7=six-amino hexanoic acid moiety |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1857.02 |
|---|---|
| Aliphatic_Index | 74.70588 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 3.52941 |
| Charge_at_pH_7 | -3.99580 |
| Isoelectric_Point | 3.63840 |
|---|---|
| Hydrogen_Bond_Acceptors | 27 |
| Hydrogen_Bond_Donors | 26 |
| Topological_Polar_Surface_Area | 823.06000 |
| X_logP_energy | -8.59513 |
Interaction Information
| Affinity | Ki=13 uM |
|---|---|
| Affinity_Assay | competitive radioligand binding assay |
| PDB_ID | 1ILP |
| Type | antagonist |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Structure of a CXC chemokine-receptor fragment in complex with interleukin-8 |
| Release_Year | 1999 |
| PMID | 10368283 |
| DOI | 10.1016/S0969-2126(99)80022-7 |