PPIRE12662
Target Protein Information
| Protein_Name | DNA-binding protein RFXANK |
|---|---|
| Protein_Sequence | MELTQPAEDLIQTQQTPASELGDPEDPGEEAADGSDTVVLSLFPCTPEPVNPEPDASVSSPQAGSSLKHSTTLTNRQRGNEVSALPATLDSLSIHQLAAQGELDQLKEHLRKGDNLVNKPDERGFTPLIWASAFGEIETVRFLLEWGADPHILAKERESALSLASTGGYTDIVGLLLERDVDINIYDWNGGTPLLYAVRGNHVKCVEALLARGADLTTEADSGYTPMDLAVALGYRKVQQVIENHILKLFQSNLVPADPE |
| Organism_Source | Homo sapiens |
| Functional_Classification | ankyrin repeat proteins |
| Cellular_Localization | Nucleus |
| Gene_Names | RFXANK |
| UniProt_ID | O14593 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | CCDC8(494-510) |
|---|---|
| Peptide_Sequence | RAFWHTPRLPTLPKRVP |
| Peptide_Length | 17 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](C)NC(=O)[C@@H](N)CCCNC(=N)N)[C@@H](C)O)C(=O)N1CCC[C@H]1C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)O)C(C)C)[C@@H](C)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 2072.49 |
|---|---|
| Aliphatic_Index | 68.82353 |
| Aromaticity | 0.11765 |
| Average_Rotatable_Bonds | 3.41176 |
| Charge_at_pH_7 | 4.08859 |
| Isoelectric_Point | 12.80743 |
|---|---|
| Hydrogen_Bond_Acceptors | 25 |
| Hydrogen_Bond_Donors | 28 |
| Topological_Polar_Surface_Area | 790.41000 |
| X_logP_energy | -4.43909 |
Interaction Information
| Affinity | KD=0.5 mM |
|---|---|
| Affinity_Assay | Isothermal titration calorimetry |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Ankyrin repeats of ANKRA2 recognize a PxLPxL motif on the 3M syndrome protein CCDC8. |
| Release_Year | 2015 |
| PMID | 25752541 |
| DOI | 10.1016/j.str.2015.02.001 |