PPIRE12935
Target Protein Information
| Protein_Name | Zinc finger protein DPF3 |
|---|---|
| Protein_Sequence | MATVIHNPLKALGDQFYKEAIEHCRSYNSRLCAERSVRLPFLDSQTGVAQNNCYIWMEKRHRGPGLAPGQLYTYPARCWRKKRRLHPPEDPKLRLLEIKPEVELPLKKDGFTSESTTLEALLRGEGVEKKVDAREEESIQEIQRVLENDENVEEGNEEEDLEEDIPKRKNRTRGRARGSAGGRRRHDAASQEDHDKPYVCDICGKRYKNRPGLSYHYAHTHLASEEGDEAQDQETRSPPNHRNENHRPQKGPDGTVIPNNYCDFCLGGSNMNKKSGRPEELVSCADCGRSGHPTCLQFTLNMTEAVKTYKWQCIECKSCILCGTSENDDQLLFCDDCDRGYHMYCLNPPVAEPPEGSWSCHLCWELLKEKASAFGCQA |
| Organism_Source | Homo sapiens |
| Functional_Classification | PHD finger |
| Cellular_Localization | Nucleus |
| Gene_Names | DPF3 |
| UniProt_ID | Q92784 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | H3K14ac(1-18) |
|---|---|
| Peptide_Sequence | ARTKQTARKSTGGKAPRK |
| Peptide_Length | 18 |
| Peptide_SMILES | C[C@H](N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@H](C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@H](C(=O)N[C@@H](C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CO)C(=O)N[C@H](C(=O)NCC(=O)NCC(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCCCN)C(=O)O)[C@@H](C)O)[C@@H](C)O)[C@@H](C)O |
| Chemical_Modification | K14=acetyl |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1942.26 |
|---|---|
| Aliphatic_Index | 16.66667 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 3.83333 |
| Charge_at_pH_7 | 6.99679 |
| Isoelectric_Point | 12.82564 |
|---|---|
| Hydrogen_Bond_Acceptors | 31 |
| Hydrogen_Bond_Donors | 36 |
| Topological_Polar_Surface_Area | 963.02000 |
| X_logP_energy | -14.82539 |
Interaction Information
| Affinity | KD=0.5 mM |
|---|---|
| Affinity_Assay | Isothermal titration calorimetry |
| PDB_ID | 2KWJ |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Mechanism and regulation of acetylated histone binding by the tandem PHD finger of DPF3b. |
| Release_Year | 2010 |
| PMID | 20613843 |
| DOI | 10.1038/nature09139 |