PPIRE13022
Target Protein Information
| Protein_Name | Golgi reassembly-stacking protein 2 |
|---|---|
| Protein_Sequence | MGSSQSVEIPGGGTEGYHVLRVQENSPGHRAGLEPFFDFIVSINGSRLNKDNDTLKDLLKANVEKPVKMLIYSSKTLELREASVTPSNLWGGQGLLGVSIRFCSFDGANENVWHVLEVESNSPAALAGLRPHSDYIIGADTVMNESEDLFSLIETHEAKPLKLYVYNTDTDNCREVIITPNSAWGGEGSLGCGIGYGYLHRIPTRPFEEGKKISLPGQMTGTPITPLKDGFTEVQLSSVSPPSLSPPGTTGVEQSLSGLSISSAPPAVSNVLSTGVPTVPLLPPQVNQSLASMPPMNPATTLPSLMPLSAGLPSLPNLPSLSNFNLPAPHIMPGVGLPELGSPGLPPLPSLPPRNLPGIAPLPMLSDFLPSFPLVPEGSSAASAGEPLSSLPAMGPPSDPVMTTAKADASSLTVDVTSPASKVPTTVEDRVSDCTPAVEKPVSDADASEPS |
| Organism_Source | Mus musculus |
| Functional_Classification | Golgi matrix proteins |
| Cellular_Localization | Cytoplasm |
| Gene_Names | Gorasp2 |
| UniProt_ID | Q99JX3 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | JAM-C peptide |
|---|---|
| Peptide_Sequence | NYIRTSEEGDFRHKSSFVI |
| Peptide_Length | 19 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CO)NC(=O)[C@H](CO)NC(=O)[C@H](CCCCN)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(=O)O)NC(=O)CNC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](N)CC(N)=O)[C@@H](C)CC)[C@@H](C)O)C(C)C)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 2285.50 |
|---|---|
| Aliphatic_Index | 56.31579 |
| Aromaticity | 0.15789 |
| Average_Rotatable_Bonds | 4.00000 |
| Charge_at_pH_7 | 0.09174 |
| Isoelectric_Point | 7.54340 |
|---|---|
| Hydrogen_Bond_Acceptors | 33 |
| Hydrogen_Bond_Donors | 37 |
| Topological_Polar_Surface_Area | 1021.76000 |
| X_logP_energy | -11.00326 |
Interaction Information
| Affinity | KD=3.7 uM |
|---|---|
| Affinity_Assay | Isothermal titration calorimetry |
| PDB_ID | 5GMI |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Genetic, structural, and chemical insights into the dual function of GRASP55 in germ cell Golgi remodeling and JAM-C polarized localization during spermatogenesis. |
| Release_Year | 2017 |
| PMID | 28617811 |
| DOI | 10.1371/journal.pgen.1006803 |