PPIRE13104
Target Protein Information
| Protein_Name | MAPK phosphothreonine lyase |
|---|---|
| Protein_Sequence | MPINRPNLNLNIPPLNIVAAYDGAEIPSTNKHLKNNFNSLHNQMRKMPVSHFKEALDVPDYSGMRQSGFFAMSQGFQLNNHGYDVFIHARRESPQSQGKFAGDKFHISVLRDMVPQAFQALSGLLFSEDSPVDKWKVTDMEKVVQQARVSLGAQFTLYIKPDQENSQYSASFLHKTRQFIECLESRLSENGVISGQCPESDVHPENWKYLSYRNELRSGRDGGEMQRQALREEPFYRLMTE |
| Organism_Source | Salmonella dublin |
| Functional_Classification | lyases |
| Cellular_Localization | Cytoplasm |
| Gene_Names | spvC |
| UniProt_ID | P0A2N0 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | Erk5 phosphopeptide |
|---|---|
| Peptide_Sequence | EHQYFMpTEpYVATR |
| Peptide_Length | 15 |
| Peptide_SMILES | CSCC[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H](N)CCC(=O)O)C(=O)N1CCC[C@H]1C(=O)N[C@H](C(=O)N[C@@H](CCC(=O)O)C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@H](C(=O)N[C@@H](C)C(=O)N[C@H](C(=O)N[C@@H](CCCNC(=N)N)C(=O)O)[C@@H](C)O)C(C)C)[C@@H](C)O |
| Chemical_Modification | T7=phosphothreonine; Y9=phosphotyrosine |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1869.08 |
|---|---|
| Aliphatic_Index | 26.00000 |
| Aromaticity | 0.20000 |
| Average_Rotatable_Bonds | 3.60000 |
| Charge_at_pH_7 | -0.90926 |
| Isoelectric_Point | 5.49296 |
|---|---|
| Hydrogen_Bond_Acceptors | 26 |
| Hydrogen_Bond_Donors | 25 |
| Topological_Polar_Surface_Area | 742.33000 |
| X_logP_energy | -5.24803 |
Interaction Information
| Affinity | KD=102 mM |
|---|---|
| Affinity_Assay | Isothermal titration calorimetry |
| PDB_ID | 2Q8Y |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Structural insights into the enzymatic mechanism of the pathogenic MAPK phosphothreonine lyase. |
| Release_Year | 2007 |
| PMID | 18060821 |
| DOI | 10.1016/j.molcel.2007.11.011 |