PPIRE13323
Target Protein Information
| Protein_Name | Apical membrane antigen 1 |
|---|---|
| Protein_Sequence | CPVFGKGIIIENSKTTFLTPVATENQDLKDGGFAFPPTKPLMSPMTLDHMRDFYKDNEYVKNLDELTLCSRHAGNMNPDNDKNSNYKYPAVYDYNDKKCHILYIAAQENNGPRYCNKDESKRNSMFCFRPAKDISFQNYTYLSKNVVDNWEKVCPRKNLQNAKFGLWVDGNCEDIPHVNEFSANDLFECNKLVFELSASDQPKQYEQHLTDYEKIKEGFKNKNASMIKSAFLPTGAFKADRYKSHGKGYNWGNYNTETHKCEIFNVKPTCLINNSSYIATTALSHPIEVENNFPCSLYKDEIMKEIERESKRIKLNDNDDEGNKKIIAPRIFISDDKDSLKCPCDPEMVSNSTCRFFVCKCVERRAEVTSNNEVVVKEEYKDEYADIPEHKPTYDNMKIIIASSAAVAVLATILMVYLYKRKGNAEKYDKMDEPQHYGKSNSRNDEMLD |
| Organism_Source | Plasmodium falciparum |
| Functional_Classification | Type I transmembrane protein |
| Cellular_Localization | Plasma membrane |
| Gene_Names | AMA1 |
| UniProt_ID | A0A0X8IHV3 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | R1 |
|---|---|
| Peptide_Sequence | VFAEFLPLFSKFGSRMHILK |
| Peptide_Length | 20 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H](CCSC)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CO)NC(=O)CNC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CO)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](C)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](N)C(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCN)C(=O)O |
| Chemical_Modification | |
| Cyclization_Method | |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 2367.88 |
|---|---|
| Aliphatic_Index | 97.50000 |
| Aromaticity | 0.20000 |
| Average_Rotatable_Bonds | 3.85000 |
| Charge_at_pH_7 | 2.09008 |
| Isoelectric_Point | 10.78905 |
|---|---|
| Hydrogen_Bond_Acceptors | 29 |
| Hydrogen_Bond_Donors | 29 |
| Topological_Polar_Surface_Area | 827.81000 |
| X_logP_energy | -2.33223 |
Interaction Information
| Affinity | KD=145 nM |
|---|---|
| Affinity_Assay | Isothermal titration calorimetry |
| PDB_ID | 3SRJ |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Structural and functional insights into the malaria parasite moving junction complex. |
| Release_Year | 2012 |
| PMID | 22737069 |
| DOI | 10.1371/journal.ppat.1002755 |