PPIRE13354
Target Protein Information
| Protein_Name | Endothelin receptor type B |
|---|---|
| Protein_Sequence | MQPLPSLCGRALVALILACGVAGIQAEEREFPPAGATQPLPGTGEMMETPTETSWPGRSNASDPRSSATPQIPRGGRMAGIPPRTPPPCDGPIEIKETFKYINTVVSCLVFVLGIIGNSTLLRIIYKNKCMRNGPNILIASLALGDLLHIIIDIPINTYKLLAKDWPFGVEMCKLVPFIQKASVGITVLSLCALSIDRYRAVASWSRIKGIGVPKWTAVEIVLIWVVSVVLAVPEAVGFDIITSDHIGNKLRICLLHPTQKTAFMQFYKTAKDWWLFSFYFCLPLAITALFYTLMTCEMLRKKSGMQIALNDHLKQRREVAKTVFCLVLVFALCWLPLHLSRILKLTLYDQHDPRRCEFLSFLLVLDYIGINMASLNSCINPIALYLVSKRFKNCFKSCLCCWCQSFEEKQSLEEKQSCLKFKANDHGYDNFRSSNKYSSS |
| Organism_Source | Bos taurus |
| Functional_Classification | G protein-coupled receptor |
| Cellular_Localization | Plasma membrane |
| Gene_Names | EDNRB |
| UniProt_ID | P28088 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | RES-701-1(1-10)/Ala15ET-3(12-21) |
|---|---|
| Peptide_Sequence | GNWHGTAPDWVYYAHLDIIW |
| Peptide_Length | 20 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H](C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H]1CCCN1C(=O)[C@H](C)NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CC(N)=O)NC(=O)CN)[C@@H](C)O)C(C)C)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC |
| Chemical_Modification | None |
| Cyclization_Method | main chain-main chain cyclization; G1<->D9; amide bond |
| Linear/Cyclic | Cyclic |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 2414.66 |
|---|---|
| Aliphatic_Index | 83.00000 |
| Aromaticity | 0.25000 |
| Average_Rotatable_Bonds | 3.30000 |
| Charge_at_pH_7 | -1.82101 |
| Isoelectric_Point | 5.25097 |
|---|---|
| Hydrogen_Bond_Acceptors | 29 |
| Hydrogen_Bond_Donors | 31 |
| Topological_Polar_Surface_Area | 890.54000 |
| X_logP_energy | -2.58160 |
Interaction Information
| Affinity | IC50=2.5 nM |
|---|---|
| Affinity_Assay | radioligand binding assay |
| PDB_ID | None |
| Type | antagonist |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Crystallographic snapshots of Tom20-mitochondrial presequence interactions with disulfide-stabilized peptides. |
| Release_Year | 1997 |
| PMID | None |
| DOI | 10.1016/S0960-894X(97)00296-5 |