PPIRE13535
Target Protein Information
| Protein_Name | Golgi reassembly-stacking protein 2 |
|---|---|
| Protein_Sequence | MGSSQSVEIPGGGTEGYHVLRVQENSPGHRAGLEPFFDFIVSINGSRLNKDNDTLKDLLKANVEKPVKMLIYSSKTLELRETSVTPSNLWGGQGLLGVSIRFCSFDGANENVWHVLEVESNSPAALAGLRPHSDYIIGADTVMNESEDLFSLIETHEAKPLKLYVYNTDTDNCREVIITPNSAWGGEGSLGCGIGYGYLHRIPTRPFEEGKKISLPGQMAGTPITPLKDGFTEVQLSSVNPPSLSPPGTTGIEQSLTGLSISSTPPAVSSVLSTGVPTVPLLPPQVNQSLTSVPPMNPATTLPGLMPLPAGLPNLPNLNLNLPAPHIMPGVGLPELVNPGLPPLPSMPPRNLPGIAPLPLPSEFLPSFPLVPESSSAASSGELLSSLPPTSNAPSDPATTTAKADAASSLTVDVTPPTAKAPTTVEDRVGDSTPVSEKPVSAAVDANASESP |
| Organism_Source | Homo sapiens |
| Functional_Classification | PDZ domain-containing proteins |
| Cellular_Localization | Cytoplasm |
| Gene_Names | GORASP2 |
| UniProt_ID | Q9H8Y8 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | Golgin45 C-terminal peptide F390A |
|---|---|
| Peptide_Sequence | TRYENITANCCNHCQGELIAL |
| Peptide_Length | 21 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCC(=O)O)NC(=O)CNC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CS)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CS)NC(=O)[C@H](CS)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](C)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](N)[C@@H](C)O)[C@@H](C)CC)[C@@H](C)O)C(=O)N[C@@H](C)C(=O)N[C@@H](CC(C)C)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 2366.67 |
|---|---|
| Aliphatic_Index | 83.80952 |
| Aromaticity | 0.04762 |
| Average_Rotatable_Bonds | 3.66667 |
| Charge_at_pH_7 | -1.09433 |
| Isoelectric_Point | 5.48560 |
|---|---|
| Hydrogen_Bond_Acceptors | 36 |
| Hydrogen_Bond_Donors | 38 |
| Topological_Polar_Surface_Area | 1043.55000 |
| X_logP_energy | -12.70043 |
Interaction Information
| Affinity | KD=0.34 uM |
|---|---|
| Affinity_Assay | Isothermal titration calorimetry |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Structural Basis for the Interaction between Golgi Reassembly-stacking Protein GRASP55 and Golgin45. |
| Release_Year | 2017 |
| PMID | 28049725 |
| DOI | 10.1074/jbc.M116.765990 |