PPIRE13617
Target Protein Information
| Protein_Name | Zinc finger protein DPF3 |
|---|---|
| Protein_Sequence | MATVIHNPLKALGDQFYKEAIEHCRSYNSRLCAERSVRLPFLDSQTGVAQNNCYIWMEKRHRGPGLAPGQLYTYPARCWRKKRRLHPPEDPKLRLLEIKPEVELPLKKDGFTSESTTLEALLRGEGVEKKVDAREEESIQEIQRVLENDENVEEGNEEEDLEEDIPKRKNRTRGRARGSAGGRRRHDAASQEDHDKPYVCDICGKRYKNRPGLSYHYAHTHLASEEGDEAQDQETRSPPNHRNENHRPQKGPDGTVIPNNYCDFCLGGSNMNKKSGRPEELVSCADCGRSGHPTCLQFTLNMTEAVKTYKWQCIECKSCILCGTSENDDQLLFCDDCDRGYHMYCLNPPVAEPPEGSWSCHLCWELLKEKASAFGCQA |
| Organism_Source | Homo sapiens |
| Functional_Classification | PHD finger |
| Cellular_Localization | Nucleus |
| Gene_Names | DPF3 |
| UniProt_ID | Q92784 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | H4-Nac(1-22) |
|---|---|
| Peptide_Sequence | SGRGKGGKGLGKGGAKRHRKVL |
| Peptide_Length | 22 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)[C@@H](NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCCCN)NC(=O)[C@H](C)NC(=O)CNC(=O)CNC(=O)[C@H](CCCCN)NC(=O)CNC(=O)[C@H](CC(C)C)NC(=O)CNC(=O)[C@H](CCCCN)NC(=O)CNC(=O)CNC(=O)[C@H](CCCCN)NC(=O)CNC(=O)[C@H](CCCNC(=N)N)NC(=O)CNC(=O)[C@@H](N)CO)C(C)C)C(=O)O |
| Chemical_Modification | N-term=acetyl |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Acetyl |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 2204.61 |
|---|---|
| Aliphatic_Index | 53.18182 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 3.77273 |
| Charge_at_pH_7 | 8.08741 |
| Isoelectric_Point | 12.83145 |
|---|---|
| Hydrogen_Bond_Acceptors | 33 |
| Hydrogen_Bond_Donors | 39 |
| Topological_Polar_Surface_Area | 1039.13000 |
| X_logP_energy | -14.20869 |
Interaction Information
| Affinity | KD=7.4 mM |
|---|---|
| Affinity_Assay | Isothermal titration calorimetry |
| PDB_ID | 2KWN |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Mechanism and regulation of acetylated histone binding by the tandem PHD finger of DPF3b. |
| Release_Year | 2010 |
| PMID | 20613843 |
| DOI | 10.1038/nature09139 |