PPIRE13625
Target Protein Information
| Protein_Name | Guanine nucleotide-binding protein G(i)subunit alpha-1 |
|---|---|
| Protein_Sequence | MGCTLSAEDKAAVERSKMIDRNLREDGEKAAREVKLLLLGAGESGKSTIVKQMKIIHEAGYSEEECKQYKAVVYSNTIQSIIAIIRAMGRLKIDFGDAARADDARQLFVLAGAAEEGFMTAELAGVIKRLWKDSGVQACFNRSREYQLNDSAAYYLNDLDRIAQPNYIPTQQDVLRTRVKTTGIVETHFTFKDLHFKMFDVGGQRSERKKWIHCFEGVTAIIFCVALSDYDLVLAEDEEMNRMHESMKLFDSICNNKWFTDTSIILFLNKKDLFEEKIKKSPLTICYPEYAGSNTYEEAAAYIQCQFEDLNKRKDTKEIYTHFTCATDTKNVQFVFDAVTDVIIKNNLKDCGLF |
| Organism_Source | Rattus norvegicus |
| Functional_Classification | GTPases |
| Cellular_Localization | Plasma membrane |
| Gene_Names | Gnai1 |
| UniProt_ID | P10824 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | GPR1 |
|---|---|
| Peptide_Sequence | EECFFDLLSKFQSSRMDDQRCPL |
| Peptide_Length | 23 |
| Peptide_SMILES | CSCC[C@H](NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CO)NC(=O)[C@H](CO)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CO)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CS)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](N)CCC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CS)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CC(C)C)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 2795.15 |
|---|---|
| Aliphatic_Index | 50.86957 |
| Aromaticity | 0.13043 |
| Average_Rotatable_Bonds | 4.08696 |
| Charge_at_pH_7 | -2.12138 |
| Isoelectric_Point | 4.22907 |
|---|---|
| Hydrogen_Bond_Acceptors | 40 |
| Hydrogen_Bond_Donors | 42 |
| Topological_Polar_Surface_Area | 1177.92000 |
| X_logP_energy | -11.63366 |
Interaction Information
| Affinity | KD=8.18 uM |
|---|---|
| Affinity_Assay | Isothermal titration calorimetry |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Thermodynamic characterization of the binding of activator of G protein signaling 3 (AGS3)and peptides derived from AGS3 with G alpha i1. |
| Release_Year | 2003 |
| PMID | 14530282 |
| DOI | 10.1074/jbc.M306300200 |