PPIRE13738
Target Protein Information
| Protein_Name | Zinc finger protein ubi-d4 |
|---|---|
| Protein_Sequence | MAAVVENVVKLLGEQYYKDAMEQCHNYNARLCAERSVRLPFLDSQTGVAQSNCYIWMEKRHRGPGLASGQLYSYPARRWRKKRRAHPPEDPRLSFPSIKPDTDQTLKKEGLISQDGSSLEALLRTDPLEKRGAPDPRVDDDSLGEFPVTNSRARKRILEPDDFLDDLDDEDYEEDTPKRRGKGKSKGKGVGSARKKLDASILEDRDKPYACDICGKRYKNRPGLSYHYAHSHLAEEEGEDKEDSQPPTPVSQRSEEQKSKKGPDGLALPNNYCDFCLGDSKINKKTGQPEELVSCSDCGRSGHPSCLQFTPVMMAAVKTYRWQCIECKCCNICGTSENDDQLLFCDDCDRGYHMYCLTPSMSEPPEGSWSCHLCLDLLKEKASIYQNQNSS |
| Organism_Source | Homo sapiens |
| Functional_Classification | histone modification reader |
| Cellular_Localization | Nucleus |
| Gene_Names | DPF2 |
| UniProt_ID | Q92785 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | H3(1-25)K14ac |
|---|---|
| Peptide_Sequence | ARTKQTARKSTGGXAPRKQLARKAA |
| Peptide_Length | 25 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H]1CCCN1C(=O)[C@H](C)NC(=O)CNC(=O)CNC(=O)CNC(=O)[C@@H](NC(=O)[C@H](CO)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](C)NC(=O)[C@@H](NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](C)N)[C@@H](C)O)[C@@H](C)O)[C@@H](C)O)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(=O)N[C@@H](C)C(=O)O |
| Chemical_Modification | X14=acetyl |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 2610.02 |
|---|---|
| Aliphatic_Index | 39.60000 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 3.68000 |
| Charge_at_pH_7 | 7.99679 |
| Isoelectric_Point | 12.99206 |
|---|---|
| Hydrogen_Bond_Acceptors | 40 |
| Hydrogen_Bond_Donors | 47 |
| Topological_Polar_Surface_Area | 1271.71000 |
| X_logP_energy | -19.16582 |
Interaction Information
| Affinity | KD=0.66 uM |
|---|---|
| Affinity_Assay | Isothermal titration calorimetry |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Selective recognition of histone crotonylation by double PHD fingers of MOZ and DPF2. |
| Release_Year | 2016 |
| PMID | 27775714 |
| DOI | 10.1038/nchembio.2218 |