PPIRE13883
Target Protein Information
| Protein_Name | Kinetochore protein SPC24/Kinetochore protein SPC25 |
|---|---|
| Protein_Sequence | MSQKDNLLDNPVEFLKEVRESFDIQQDVDAMKRIRHDLDVIKEESEARISKEHSKVSESNKKLNAERINVAKLEGDLEYTNEESNEFGSKDELVKLLKDLDGLERNIVSLRSELDEKMKLYLKDSEIISTPNGSKIKAKVIEPELEEQSAVTPEANENILKLKLYRSLGVILDLENDQVLINRKNDGNIDILPLDNNLSDFYKTKYIWERLGK/MASIDAFSDLERRMDGFQKDVAQVLARQQNHARQQLQQFQAEMRQLHNQHQHLIDELQRLATQRTALQQQIHAAQQATNTTREQWRSYHERESELSRRQSTLAAQSRELDSLLQQRGKECVQLRARWAAQSGNDAAEVALYERLLQLRVLPGASDVHDVRFVFGDDSRCWIEVAMHGDHVIGNSHPALDPKSRATLEHVLTVQGDLAAFLVVARDMLLASL |
| Organism_Source | Saccharomyces cerevisiae (strain ATCC 204508 / S288c)/Saccharomyces cerevisiae (strain ATCC 204508 / S288c) |
| Functional_Classification | kinetochore proteins |
| Cellular_Localization | Nucleus |
| Gene_Names | SPC24/SPC25 |
| UniProt_ID | Q04477/P40014 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | Cnn1(60-84) |
|---|---|
| Peptide_Sequence | NKDPNEVRSFLQDLSQVLARKSQGN |
| Peptide_Length | 25 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CO)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](N)CC(N)=O)C(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCC(N)=O)C(=O)NCC(=O)N[C@@H](CC(N)=O)C(=O)O)C(C)C |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 2844.14 |
|---|---|
| Aliphatic_Index | 74.00000 |
| Aromaticity | 0.04000 |
| Average_Rotatable_Bonds | 3.96000 |
| Charge_at_pH_7 | 1.00006 |
| Isoelectric_Point | 9.53242 |
|---|---|
| Hydrogen_Bond_Acceptors | 42 |
| Hydrogen_Bond_Donors | 45 |
| Topological_Polar_Surface_Area | 1359.90000 |
| X_logP_energy | -18.11766 |
Interaction Information
| Affinity | KD=3.5 uM |
|---|---|
| Affinity_Assay | Isothermal titration calorimetry |
| PDB_ID | 4GEQ |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | A structural basis for kinetochore recruitment of the Ndc80 complex via two distinct centromere receptors. |
| Release_Year | 2013 |
| PMID | 23334295 |
| DOI | 10.1038/emboj.2012.356 |