PPIRE13887
Target Protein Information
| Protein_Name | NEDD8-activating enzyme E1 catalytic subunit |
|---|---|
| Protein_Sequence | MADGEEPEKKRRRIEELLAEKMAVDGGCGDTGDWEGRWNHVKKFLERSGPFTHPDFEPSTESLQFLLDTCKVLVIGAGGLGCELLKNLALSGFRQIHVIDMDTIDVSNLNRQFLFRPKDIGRPKAEVAAEFLNDRVPNCNVVPHFNKIQDFNDTFYRQFHIIVCGLDSIIARRWINGMLISLLNYEDGVLDPSSIVPLIDGGTEGFKGNARVILPGMTACIECTLELYPPQVNFPMCTIASMPRLPEHCIEYVRMLQWPKEQPFGEGVPLDGDDPEHIQWIFQKSLERASQYNIRGVTYRLTQGVVKRIIPAVASTNAVIAAVCATEVFKIATSAYIPLNNYLVFNDVDGLYTYTFEAERKENCPACSQLPQNIQFSPSAKLQEVLDYLTNSASLQMKSPAITATLEGKNRTLYLQSVTSIEERTRPNLSKTLKELGLVDGQELAVADVTTPQTVLFKLHFTS |
| Organism_Source | Homo sapiens |
| Functional_Classification | ubiquitin-like protein activating enzymes |
| Cellular_Localization | Cytoplasm |
| Gene_Names | UBA3 |
| UniProt_ID | Q8TBC4 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | Ubc12N26 |
|---|---|
| Peptide_Sequence | MIKLFSLKQQKKEEESAGGTKGSSKK |
| Peptide_Length | 26 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@@H](N)CCSC)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)NCC(=O)NCC(=O)N[C@H](C(=O)N[C@@H](CCCCN)C(=O)NCC(=O)N[C@@H](CO)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCCN)C(=O)O)[C@@H](C)O |
| Chemical_Modification | |
| Cyclization_Method | |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 2868.34 |
|---|---|
| Aliphatic_Index | 48.84615 |
| Aromaticity | 0.03846 |
| Average_Rotatable_Bonds | 4.23077 |
| Charge_at_pH_7 | 4.00124 |
| Isoelectric_Point | 10.67716 |
|---|---|
| Hydrogen_Bond_Acceptors | 45 |
| Hydrogen_Bond_Donors | 44 |
| Topological_Polar_Surface_Area | 1272.19000 |
| X_logP_energy | -15.05510 |
Interaction Information
| Affinity | Ki=22 uM |
|---|---|
| Affinity_Assay | Enzyme Inhibition Kinetics |
| PDB_ID | 1TT5 |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | A unique E1-E2 interaction required for optimal conjugation of the ubiquitin-like protein NEDD8. |
| Release_Year | 2004 |
| PMID | 15361859 |
| DOI | 10.1038/nsmb826 |