PPIRE13959
Target Protein Information
| Protein_Name | Minor fimbrium subunit Mfa1 |
|---|---|
| Protein_Sequence | MKLNKMFLVGALLSLGFASCSKEGNGPAPDSSSTADTHMSVSMSLPQHNRAGDNDYNPIGEYGGVDKINDLTVYVVGDGKIDVRKLSTADLQVNQGASTTSIVTAPFQVKSGEKTVYAIVNITPKVEAALNAATNAADLKVAYEAAYAAFSDAGSEIATLVNNQDQMIMSGKPVVQTILANVSAANASVQNKVPIIVKRAAIRASMTITQQPVNGAYEIKALRPGNVEVGIATVSDLKWAVAQYEKKYYLQQKDNALSPAASFVPASTNDYNGANGAMKHYDYSQLANRITVHQLNAPYSVTDVPNVAYKYVSETTHADNDYRKGNTTYILVKGKLKPVAAMWADGEQAAYQEGGDLFLGLVTGKFYANEANANAANPASGGAGNPRVVTYKAAAVYYYAWLNPNTLDPTTWTMSPARRNNIYNVNISKFRNIGLSGNPFVPTDPDPNNPDTPDNPDTPDPEDPDTPNPEEPLPVQKTYMVVDVTVTPWTLHNYDIEF |
| Organism_Source | Porphyromonas gingivalis |
| Functional_Classification | adhesins |
| Cellular_Localization | Plasma membrane |
| Gene_Names | mfa1 |
| UniProt_ID | P81363 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | BAR |
|---|---|
| Peptide_Sequence | LEAAPKKVQDLLKKANITVKGAFQLFS |
| Peptide_Length | 27 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](C)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@@H]1CCCN1C(=O)[C@H](C)NC(=O)[C@H](C)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](N)CC(C)C)C(C)C)C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](CCCCN)C(=O)NCC(=O)N[C@@H](C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CO)C(=O)O)C(C)C)[C@@H](C)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 2958.54 |
|---|---|
| Aliphatic_Index | 108.51852 |
| Aromaticity | 0.07407 |
| Average_Rotatable_Bonds | 3.81481 |
| Charge_at_pH_7 | 2.99873 |
| Isoelectric_Point | 10.62727 |
|---|---|
| Hydrogen_Bond_Acceptors | 40 |
| Hydrogen_Bond_Donors | 39 |
| Topological_Polar_Surface_Area | 1185.56000 |
| X_logP_energy | -8.98780 |
Interaction Information
| Affinity | IC50=1.3 uM |
|---|---|
| Affinity_Assay | Enzyme Inhibition Kinetics |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Peptide-modified nanoparticles inhibit formation of Porphyromonas gingivalis biofilms with Streptococcus gordonii. |
| Release_Year | 2017 |
| PMID | 28790818 |
| DOI | 10.2147/IJN.S139178 |