PPIRE14097
Target Protein Information
| Protein_Name | Neuropeptide Y receptor type 1 |
|---|---|
| Protein_Sequence | MNSTLFSRVENYSVHYNVSENSPFLAFENDDCHLPLAVIFTLALAYGAVIILGVSGNLALIIIILKQKEMRNVTNILIVNLSFSDLLVAVMCLPFTFVYTLMDHWVFGETMCKLNPFVQCVSITVSIFSLVLIAVERHQLIINPRGWRPNNRHAYIGITVIWVLAVASSLPFVIYQILTDEPFQNVSLAAFKDKYVCFDKFPSDSHRLSYTTLLLVLQYFGPLCFIFICYFKIYIRLKRRNNMMDKIRDSKYRSSETKRINVMLLSIVVAFAVCWLPLTIFNTVFDWNHQIIATCNHNLLFLLCHLTAMISTCVNPIFYGFLNKNFQRDLQFFFNFCDFRSRDDDYETIAMSTMHTDVSKTSLKQASPVAFKKISMNDNEKI |
| Organism_Source | Rattus norvegicus |
| Functional_Classification | G protein-coupled receptor |
| Cellular_Localization | Plasma membrane |
| Gene_Names | Npy1r |
| UniProt_ID | P21555 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | [Leu31-Pro34]NPY |
|---|---|
| Peptide_Sequence | SLRRSSCFGGRMDRIGAQSGLGCNSFRY |
| Peptide_Length | 28 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@H](CCCNC(=N)N)NC(=O)CNC(=O)CNC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CS)NC(=O)[C@H](CO)NC(=O)[C@H](CO)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](N)CO)C(=O)NCC(=O)N[C@@H](C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CO)C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CS)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 3082.48 |
|---|---|
| Aliphatic_Index | 45.35714 |
| Aromaticity | 0.10714 |
| Average_Rotatable_Bonds | 3.71429 |
| Charge_at_pH_7 | 3.87361 |
| Isoelectric_Point | 10.94697 |
|---|---|
| Hydrogen_Bond_Acceptors | 46 |
| Hydrogen_Bond_Donors | 55 |
| Topological_Polar_Surface_Area | 1403.38000 |
| X_logP_energy | -20.25705 |
Interaction Information
| Affinity | Ki=1.6 nM |
|---|---|
| Affinity_Assay | receptor autoradiography |
| PDB_ID | None |
| Type | Agonist |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Production in Pichia pastoris of complementary protein-based polymers with heterodimer-forming WW and PPxY domains. |
| Release_Year | 1997 |
| PMID | None |
| DOI | 10.1152/ajprenal.1997.273.2.F545 |