PPIRE14117
Target Protein Information
| Protein_Name | High affinity immunoglobulin gamma Fc receptor I |
|---|---|
| Protein_Sequence | MWFLTTLLLWVPVDGQVDTTKAVITLQPPWVSVFQEETVTLHCEVLHLPGSSSTQWFLNGTATQTSTPSYRITSASVNDSGEYRCQRGLSGRSDPIQLEIHRGWLLLQVSSRVFTEGEPLALRCHAWKDKLVYNVLYYRNGKAFKFFHWNSNLTILKTNISHNGTYHCSGMGKHRYTSAGISVTVKELFPAPVLNASVTSPLLEGNLVTLSCETKLLLQRPGLQLYFSFYMGSKTLRGRNTSSEYQILTARREDSGLYWCEAATEDGNVLKRSPELELQVLGLQLPTPVWFHVLFYLAVGIMFLVNTVLWVTIRKELKRKKKWDLEISLDSGHEKKVISSLQEDRHLEEELKCQEQKEEQLQEGVHRKEPQGAT |
| Organism_Source | Homo sapiens |
| Functional_Classification | Fc receptors |
| Cellular_Localization | Plasma membrane |
| Gene_Names | FCGR1A |
| UniProt_ID | P12314 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | cyclic hinge-loop peptide |
|---|---|
| Peptide_Sequence | FCAKVNNKDLPAPIEKELLGGGPSVFCI |
| Peptide_Length | 28 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](CS)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](NC(=O)[C@H](CO)NC(=O)[C@@H]1CCCN1C(=O)CNC(=O)CNC(=O)CNC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](NC(=O)[C@@H]1CCCN1C(=O)[C@H](C)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H](NC(=O)[C@H](CCCCN)NC(=O)[C@H](C)NC(=O)[C@H](CS)NC(=O)[C@@H](N)Cc1ccccc1)C(C)C)[C@@H](C)CC)C(C)C)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | Side chain-side chain cyclization; C2<->C27; disulfide bond |
| Linear/Cyclic | Cyclic |
| N-terminal_Modification | Acetyl |
| C-terminal_Modification | amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 2960.50 |
|---|---|
| Aliphatic_Index | 97.50000 |
| Aromaticity | 0.07143 |
| Average_Rotatable_Bonds | 3.39286 |
| Charge_at_pH_7 | -0.12285 |
| Isoelectric_Point | 6.31058 |
|---|---|
| Hydrogen_Bond_Acceptors | 40 |
| Hydrogen_Bond_Donors | 37 |
| Topological_Polar_Surface_Area | 1119.02000 |
| X_logP_energy | -8.83760 |
Interaction Information
| Affinity | IC50=40 uM |
|---|---|
| Affinity_Assay | radioligand binding assay |
| PDB_ID | None |
| Type | antagonist |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | The interplay between citrullination and HLA-DRB1 polymorphism in shaping peptide binding hierarchies in rheumatoid arthritis. |
| Release_Year | 1999 |
| PMID | None |
| DOI | 10.1002/(SICI)1099-1387(199912)5:12<555::AID-PSC220>3.0.CO;2-G |