PPIRE14168
Target Protein Information
| Protein_Name | Vasoactive intestinal polypeptide receptor 1 |
|---|---|
| Protein_Sequence | MRPPSPLPARWLCVLAGALAWALGPAGGQAARLQEECDYVQMIEVQHKQCLEEAQLENETIGCSKMWDNLTCWPATPRGQVVVLACPLIFKLFSSIQGRNVSRSCTDEGWTHLEPGPYPIACGLDDKAASLDEQQTMFYGSVKTGYTIGYGLSLATLLVATAILSLFRKLHCTRNYIHMHLFISFILRAAAVFIKDLALFDSGESDQCSEGSVGCKAAMVFFQYCVMANFFWLLVEGLYLYTLLAVSFFSERKYFWGYILIGWGVPSTFTMVWTIARIHFEDYGCWDTINSSLWWIIKGPILTSILVNFILFICIIRILLQKLRPPDIRKSDSSPYSRLARSTLLLIPLFGVHYIMFAFFPDNFKPEVKMVFELVVGSFQGFVVAILYCFLNGEVQAELRRKWRRWHLQGVLGWNPKYRHPSGGSNGATCSTQVSMLTRVSPGARRSSSFQAEVSLV |
| Organism_Source | Homo sapiens |
| Functional_Classification | G protein-coupled receptor |
| Cellular_Localization | Plasma membrane |
| Gene_Names | VIPR1 |
| UniProt_ID | P32241 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | (A-NL-K)VIP-L2-CPT |
|---|---|
| Peptide_Sequence | HADAVFTAAYTRLRKQXAAKKYLAAIAKX |
| Peptide_Length | 29 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@H](C)NC(=O)[C@H](C)NC(=O)CNC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](C)NC(=O)[C@H](C)NC(=O)[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)NC(=O)[C@@H](N)Cc1c[nH]cn1)C(C)C)[C@@H](C)O)[C@@H](C)O)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCCN)C(=O)NCC(=O)O |
| Chemical_Modification | X17=Norleucine; X29=carbamate bond to camptothecin |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 3091.61 |
|---|---|
| Aliphatic_Index | 81.37931 |
| Aromaticity | 0.10345 |
| Average_Rotatable_Bonds | 3.55172 |
| Charge_at_pH_7 | 5.08645 |
| Isoelectric_Point | 10.90013 |
|---|---|
| Hydrogen_Bond_Acceptors | 43 |
| Hydrogen_Bond_Donors | 47 |
| Topological_Polar_Surface_Area | 1295.99000 |
| X_logP_energy | -12.14166 |
Interaction Information
| Affinity | IC50=126 nM |
|---|---|
| Affinity_Assay | radioligand competition binding assay |
| PDB_ID | None |
| Type | Agonist |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Vasoactive intestinal peptide-camptothecin conjugates inhibit the proliferation of breast cancer cells. |
| Release_Year | 2007 |
| PMID | 17580098 |
| DOI | 10.1016/j.peptides.2007.04.017 |