PPIRE15107
Target Protein Information
| Protein_Name | High affinity immunoglobulin epsilon receptor subunit alpha |
|---|---|
| Protein_Sequence | MAPAMESPTLLCVALLFFAPDGVLAVPQKPKVSLNPPWNRIFKGENVTLTCNGNNFFEVSSTKWFHNGSLSEETNSSLNIVNAKFEDSGEYKCQHQQVNESEPVYLEVFSDWLLLQASAEVVMEGQPLFLRCHGWRNWDVYKVIYYKDGEALKYWYENHNISITNATVEDSGTYYCTGKVWQLDYESEPLNITVIKAPREKYWLQFFIPLLVVILFAVDTGLFISTQQQVTFLLKIKRTRKGFRLLNPHPKPNPKNN |
| Organism_Source | Homo sapiens |
| Functional_Classification | immunoglobulin receptors |
| Cellular_Localization | plasma membrane |
| Gene_Names | FCER1A |
| UniProt_ID | P12319 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | IGE06 |
|---|---|
| Peptide_Sequence | NLPRCTEGPWGWVCMAAD |
| Peptide_Length | 18 |
| Peptide_SMILES | CSCC[C@H](NC(=O)[C@H](CS)NC(=O)[C@@H](NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)CNC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@@H]1CCCN1C(=O)CNC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](NC(=O)[C@H](CS)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CC(C)C)NC(=O)[C@@H](N)CC(N)=O)[C@@H](C)O)C(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](C)C(=O)N[C@@H](CC(=O)O)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | Side chain-side chain cyclization; C5<->C14; disulfide bond |
| Linear/Cyclic | Cyclic |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 2006.30 |
|---|---|
| Aliphatic_Index | 48.88889 |
| Aromaticity | 0.11111 |
| Average_Rotatable_Bonds | 3.16667 |
| Charge_at_pH_7 | -1.12375 |
| Isoelectric_Point | 4.18434 |
|---|---|
| Hydrogen_Bond_Acceptors | 27 |
| Hydrogen_Bond_Donors | 28 |
| Topological_Polar_Surface_Area | 771.84000 |
| X_logP_energy | -6.42333 |
Interaction Information
| Affinity | IC50=3.6 uM |
|---|---|
| Affinity_Assay | ELISA |
| PDB_ID | 1JBF |
| Type | antagonist |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Convergent recognition of the IgE binding site on the high-affinity IgE receptor. |
| Release_Year | 2004 |
| PMID | 15242605 |
| DOI | 10.1016/j.str.2004.04.015 |