PPIRE15108
Target Protein Information
| Protein_Name | High affinity immunoglobulin epsilon receptor subunit alpha |
|---|---|
| Protein_Sequence | MAPAMESPTLLCVALLFFAPDGVLAVPQKPKVSLNPPWNRIFKGENVTLTCNGNNFFEVSSTKWFHNGSLSEETNSSLNIVNAKFEDSGEYKCQHQQVNESEPVYLEVFSDWLLLQASAEVVMEGQPLFLRCHGWRNWDVYKVIYYKDGEALKYWYENHNISITNATVEDSGTYYCTGKVWQLDYESEPLNITVIKAPREKYWLQFFIPLLVVILFAVDTGLFISTQQQVTFLLKIKRTRKGFRLLNPHPKPNPKNN |
| Organism_Source | Homo sapiens |
| Functional_Classification | immunoglobulin receptors |
| Cellular_Localization | plasma membrane |
| Gene_Names | FCER1A |
| UniProt_ID | P12319 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | e109 |
|---|---|
| Peptide_Sequence | VQCPHFCYELDYELCPDVCYV |
| Peptide_Length | 21 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CS)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CS)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](N)C(C)C)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CS)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CS)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@H](C(=O)O)C(C)C)C(C)C |
| Chemical_Modification | None |
| Cyclization_Method | Side chain-side chain cyclization; C3<->C17; disulfide bond |
| Linear/Cyclic | Cyclic |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 2538.91 |
|---|---|
| Aliphatic_Index | 78.57143 |
| Aromaticity | 0.19048 |
| Average_Rotatable_Bonds | 3.47619 |
| Charge_at_pH_7 | -4.15711 |
| Isoelectric_Point | 3.73724 |
|---|---|
| Hydrogen_Bond_Acceptors | 35 |
| Hydrogen_Bond_Donors | 33 |
| Topological_Polar_Surface_Area | 909.40000 |
| X_logP_energy | -4.11600 |
Interaction Information
| Affinity | IC50=1.4 uM |
|---|---|
| Affinity_Assay | ELISA |
| PDB_ID | None |
| Type | antagonist |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Convergent recognition of the IgE binding site on the high-affinity IgE receptor. |
| Release_Year | 2004 |
| PMID | 15242605 |
| DOI | 10.1016/j.str.2004.04.015 |