PPIRE15111
Target Protein Information
| Protein_Name | Immunoglobulin heavy constant gamma 2B |
|---|---|
| Protein_Sequence | KTTPPSVYPLAPGCGDTTGSSVTLGCLVKGYFPESVTVTWNSGSLSSSVHTFPALLQSGLYTMSSSVTVPSSTWPSQTVTCSVAHPASSTTVDKKLEPSGPISTINPCPPCKECHKCPAPNLEGGPSVFIFPPNIKDVLMISLTPKVTCVVVDVSEDDPDVQISWFVNNVEVHTAQTQTHREDYNSTIRVVSTLPIQHQDWMSGKEFKCKVNNKDLPSPIERTISKIKGLVRAPQVYILPPPAEQLSRKDVSLTCLVVGFNPGDISVEWTSNGHTEENYKDTAPVLDSDGSYFIYSKLNMKTSKWEKTDSFSCNVRHEGLKNYYLKKTISRSPGLDLDDICAEAKDGELDGLWTTITIFISLFLLSVCYSASVTLFKVKWIFSSVVELKQKISPDYRNMIGQGA |
| Organism_Source | Mus musculus |
| Functional_Classification | immunoglobulins |
| Cellular_Localization | extracellular |
| Gene_Names | Ighg2b |
| UniProt_ID | P01866 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | D-peptide vpGsqhyds |
|---|---|
| Peptide_Sequence | vpGsqhyds |
| Peptide_Length | 9 |
| Peptide_SMILES | CC(C)[C@H](N)C(=O)N1CCC[C@H]1C(=O)NCC(=O)N[C@@H](CO)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CO)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 989.01 |
|---|---|
| Aliphatic_Index | 32.22222 |
| Aromaticity | 0.11111 |
| Average_Rotatable_Bonds | 3.11111 |
| Charge_at_pH_7 | -0.91151 |
| Isoelectric_Point | 5.29220 |
|---|---|
| Hydrogen_Bond_Acceptors | 16 |
| Hydrogen_Bond_Donors | 15 |
| Topological_Polar_Surface_Area | 457.09000 |
| X_logP_energy | -6.29080 |
Interaction Information
| Affinity | KD=6 uM |
|---|---|
| Affinity_Assay | ELISA |
| PDB_ID | 1ZEA |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Structure of an anti-cholera toxin antibody Fab in complex with an epitope-derived D-peptide: a case of polyspecific recognition. |
| Release_Year | 2007 |
| PMID | 17712773 |
| DOI | 10.1002/jmr.838 |