PPIRE15229
Target Protein Information
| Protein_Name | Immunoglobulin heavy constant epsilon |
|---|---|
| Protein_Sequence | VSVKAPSLYPLKPCSSENTASVTLGCLVKDYFPDPVTVTWYSDSLNTSTMNFPSIGSDLKTTTSQMTSWGKSAKNFTCHVTHAPSTFVSDLTIRARPVNITKPTVDLLHSSCDPNAFHSTIQLYCFVYGHIQNDVSIHWLMDDRKIYETHAQNVLIKEEGKLASTYSRLNITQQQWMSESTFTCKVTSQGENYWAHTRRCSDDEPRGVITYLIPPSPLDLYENGTPKLTCLVLDLESEENITVTWVRERKKSIGSASQRSTKHHNATTSITSILPVDAKDWIEGEGYQCRVDHPHFPKPIVRSITKAPGKRSAPEVYVFLPPEEEEKDKRTLTCLIQNFFPEDISVQWLQDSKLIPKSQHSTTTPLKYNGSNQRFFIFSRLEVTKALWTQTKQFTCRVIHEALREPRKLERTISKSLGNTSLRPSQASM |
| Organism_Source | Rattus norvegicus |
| Functional_Classification | immunoglobulins |
| Cellular_Localization | Extracellular |
| Gene_Names | IGHE |
| UniProt_ID | P01855 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | P124 (heated IgE) |
|---|---|
| Peptide_Sequence | YVFLPPEEEEKRYR |
| Peptide_Length | 14 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(C)C)C(=O)N1CCC[C@H]1C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1855.08 |
|---|---|
| Aliphatic_Index | 48.57143 |
| Aromaticity | 0.21429 |
| Average_Rotatable_Bonds | 4.14286 |
| Charge_at_pH_7 | -0.99692 |
| Isoelectric_Point | 4.62819 |
|---|---|
| Hydrogen_Bond_Acceptors | 24 |
| Hydrogen_Bond_Donors | 26 |
| Topological_Polar_Surface_Area | 763.52000 |
| X_logP_energy | -3.33076 |
Interaction Information
| Affinity | IC50=0.14 uM |
|---|---|
| Affinity_Assay | ELISA |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Use of synthetic peptides in the production and characterization of antibodies directed against predetermined specificities in rat immunoglobulin E |
| Release_Year | 1986 |
| PMID | 3702875 |
| DOI | 10.1016/0161-5890(86)90041-6 |