PPIRE15415
Target Protein Information
| Protein_Name | Advanced glycosylation end product-specific receptor |
|---|---|
| Protein_Sequence | MAAGTAVGAWVLVLSLWGAVVGAQNITARIGEPLVLKCKGAPKKPPQRLEWKLNTGRTEAWKVLSPQGGGPWDSVARVLPNGSLFLPAVGIQDEGIFRCQAMNRNGKETKSNYRVRVYQIPGKPEIVDSASELTAGVPNKVGTCVSEGSYPAGTLSWHLDGKPLVPNEKGVSVKEQTRRHPETGLFTLQSELMVTPARGGDPRPTFSCSFSPGLPRHRALRTAPIQPRVWEPVPLEEVQLVVEPEGGAVAPGGTVTLTCEVPAQPSPQIHWMKDGVPLPLPPSPVLILPEIGPQDQGTYSCVATHSSHGPQESRAVSISIIEPGEEGPTAGSVGGSGLGTLALALGILGGLGTAALLIGVILWQRRQRRGEERKAPENQEEEEERAELNQSEEPEAGESSTGGP |
| Organism_Source | Homo sapiens |
| Functional_Classification | pattern recognition receptor |
| Cellular_Localization | Extracellular |
| Gene_Names | AGER |
| UniProt_ID | Q15109 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | PA #103 |
|---|---|
| Peptide_Sequence | IQLRVRMKLV |
| Peptide_Length | 10 |
| Peptide_SMILES | CC[C@H](C)[C@H](N)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@H](C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C(=O)O)C(C)C)C(C)C |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1255.63 |
|---|---|
| Aliphatic_Index | 175.00000 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 4.50000 |
| Charge_at_pH_7 | 2.99768 |
| Isoelectric_Point | 12.51648 |
|---|---|
| Hydrogen_Bond_Acceptors | 16 |
| Hydrogen_Bond_Donors | 19 |
| Topological_Polar_Surface_Area | 518.13000 |
| X_logP_energy | -2.11406 |
Interaction Information
| Affinity | KD=1 uM |
|---|---|
| Affinity_Assay | ELISA |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Combinatorial Library of Improved Peptide Aptamers CLIPs to Inhibit RAGE Signal Transduction in Mammalian Cells |
| Release_Year | 2013 |
| PMID | 23785412 |
| DOI | 10.1371/journal.pone.0065180 |