PPIRE15585
Target Protein Information
| Protein_Name | Proto-oncogene tyrosine-protein kinase LCK |
|---|---|
| Protein_Sequence | MGCVCSSNPEDDWMENIDVCENCHYPIVPLDSKISLPIRNGSEVRDPLVTYEGSLPPASPLQDNLVIALHSYEPSHDGDLGFEKGEQLRILEQSGEWWKAQSLTTGQEGFIPFNFVAKANSLEPEPWFFKNLSRKDAERQLLAPGNTHGSFLIRESESTAGSFSLSVRDFDQNQGEVVKHYKIRNLDNGGFYISPRITFPGLHDLVRHYTNASDGLCTKLSRPCQTQKPQKPWWEDEWEVPRETLKLVERLGAGQFGEVWMGYYNGHTKVAVKSLKQGSMSPDAFLAEANLMKQLQHPRLVRLYAVVTQEPIYIITEYMENGSLVDFLKTPSGIKLNVNKLLDMAAQIAEGMAFIEEQNYIHRDLRAANILVSDTLSCKIADFGLARLIEDNEYTAREGAKFPIKWTAPEAINYGTFTIKSDVWSFGILLTEIVTHGRIPYPGMTNPEVIQNLERGYRMVRPDNCPEELYHLMMLCWKERPEDRPTFDYLRSVLDDFFTATEGQYQPQP |
| Organism_Source | Mus musculus |
| Functional_Classification | tyrosine kinases |
| Cellular_Localization | Plasma membrane |
| Gene_Names | Lck |
| UniProt_ID | P06240 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | hmT 11-mer phosphotyrosine peptide |
|---|---|
| Peptide_Sequence | EPQXEEIPIYL |
| Peptide_Length | 11 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@@H]1CCCN1C(=O)[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)CNC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)CCC(=O)O)[C@@H](C)CC)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CC(C)C)C(=O)O |
| Chemical_Modification | X4=phosphotyrosine |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1287.43 |
|---|---|
| Aliphatic_Index | 106.36364 |
| Aromaticity | 0.09091 |
| Average_Rotatable_Bonds | 3.54545 |
| Charge_at_pH_7 | -2.99754 |
| Isoelectric_Point | 3.47280 |
|---|---|
| Hydrogen_Bond_Acceptors | 17 |
| Hydrogen_Bond_Donors | 15 |
| Topological_Polar_Surface_Area | 511.96000 |
| X_logP_energy | -2.16340 |
Interaction Information
| Affinity | KD=0.07 uM |
|---|---|
| Affinity_Assay | Surface Plasmon Resonance |
| PDB_ID | 1LCJ |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Experimental and Calculated Shift in pKa upon Binding of Phosphotyrosine Peptide to the SH2 Domain of p56lck |
| Release_Year | 2002 |
| PMID | 11886810 |
| DOI | 10.1016/S0968-0896(01)00407-2 |