PPIRE15753
Target Protein Information
| Protein_Name | Cell surface-binding protein OPG105 |
|---|---|
| Protein_Sequence | MPQQLSPINIETKKAISNARLKPLDIHYNESKPTTIQNTGKLVRINFKGGYISGGFLPNEYVLSSLHIYWGKEDDYGSNHLIDVYKYSGEINLVHWNKKKYSSYEEAKKHDDGLIIISIFLQVSDHKNVYFQKIVNQLDSIRSANTSAPFDSVFYLDNLLPSTLDYFTYLGTTIKHSADAVWIIFPTPINIHSDQLSKFRTLLSSSNHDGKPYYITENYRNPYKLNDDTQVYYSGEIIRAATTSPARENYFMRWLSDLRETCFSYYQKYIEGNKTFAIIAIVFVFILTAILFLMSRRYSREKQN |
| Organism_Source | Vaccinia virus (strain Copenhagen) |
| Functional_Classification | envelope proteins |
| Cellular_Localization | Extracellular |
| Gene_Names | OPG105 |
| UniProt_ID | P20508 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | uVACVpep05 |
|---|---|
| Peptide_Sequence | TADKLLYGLFKSGGGSK |
| Peptide_Length | 17 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)CNC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)NC(=O)[C@@H](N)[C@@H](C)O)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CO)C(=O)NCC(=O)NCC(=O)NCC(=O)N[C@@H](CO)C(=O)N[C@@H](CCCCN)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Acetyl |
| C-terminal_Modification | Amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1742.00 |
|---|---|
| Aliphatic_Index | 74.70588 |
| Aromaticity | 0.11765 |
| Average_Rotatable_Bonds | 3.52941 |
| Charge_at_pH_7 | 1.99670 |
| Isoelectric_Point | 10.11959 |
|---|---|
| Hydrogen_Bond_Acceptors | 26 |
| Hydrogen_Bond_Donors | 26 |
| Topological_Polar_Surface_Area | 725.20000 |
| X_logP_energy | -7.74300 |
Interaction Information
| Affinity | KD=1.1 uM |
|---|---|
| Affinity_Assay | Surface Plasmon Resonance |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Identification and characterization of a phage display-derived peptide for orthopoxvirus detection |
| Release_Year | 2014 |
| PMID | 25311190 |
| DOI | 10.1007/s00216-014-8150-8 |