PPIRE15775
Target Protein Information
| Protein_Name | Paired immunoglobulin-like type 2 receptor alpha |
|---|---|
| Protein_Sequence | MGRPLLLPLLPLLLPPAFLQPSGSTGSGPSYLYGVTQPKHLSASMGGSVEIPFSFYYPWELATAPDVRISWRRGHFHRQSFYSTRPPSIHKDYVNRLFLNWTEGQKSGFLRISNLQKQDQSVYFCRVELDTRSSGRQQWQSIEGTKLSITQAVTTTTQRPSSMTTTWRLSSTTTTTGLRVTQGKRRSDSWHISLETAVGVAVAVTVLGIMILGLICLLRWRRRKGQQRTKATTPAREPFQNTEEPYENIRNEGQNTDPKLNPKDDGIVYASLALSSSTSPRAPPSHRPLKSPQNETLYSVLKA |
| Organism_Source | Homo sapiens |
| Functional_Classification | immunoglobulin like receptors |
| Cellular_Localization | Plasma membrane |
| Gene_Names | PILRA |
| UniProt_ID | Q9UKJ1 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | HSV-1 gB glycopeptide (residues 506) |
|---|---|
| Peptide_Sequence | GPATPAP |
| Peptide_Length | 7 |
| Peptide_SMILES | C[C@H](NC(=O)[C@@H]1CCCN1C(=O)CN)C(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)N[C@@H](C)C(=O)N1CCC[C@H]1C(=O)O)[C@@H](C)O |
| Chemical_Modification | T4=Neu5Acu2-6GalNAc |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 609.68 |
|---|---|
| Aliphatic_Index | 28.57143 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 1.57143 |
| Charge_at_pH_7 | -0.00202 |
| Isoelectric_Point | 6.10000 |
|---|---|
| Hydrogen_Bond_Acceptors | 9 |
| Hydrogen_Bond_Donors | 6 |
| Topological_Polar_Surface_Area | 231.78000 |
| X_logP_energy | -3.12230 |
Interaction Information
| Affinity | KD=2.3 uM |
|---|---|
| Affinity_Assay | Surface Plasmon Resonance |
| PDB_ID | 3WV0 |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Structural basis for simultaneous recognition of an O-glycan and its attached peptide of mucin family by immune receptor PILRu |
| Release_Year | 2014 |
| PMID | 24889612 |
| DOI | 10.1073/pnas.1324105111 |