PPIRE16043
Target Protein Information
| Protein_Name | Interleukin-8 |
|---|---|
| Protein_Sequence | MTSKLAVALLAAFLISAALCEGAVLPRSAKELRCQCIKTYSKPFHPKFIKELRVIESGPHCANTEIIVKLSDGRELCLDPKENWVQRVVEKFLKRAENS |
| Organism_Source | Homo sapiens |
| Functional_Classification | chemokines |
| Cellular_Localization | Extracellular |
| Gene_Names | CXCL8 |
| UniProt_ID | P10145 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | CXCR1 N-terminal 17mer |
|---|---|
| Peptide_Sequence | MWDFDDXMPPADEDYSP |
| Peptide_Length | 17 |
| Peptide_SMILES | CSCC[C@H](NC(=O)CNC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@@H](N)CCSC)C(=O)N1CCC[C@H]1C(=O)N1CCC[C@H]1C(=O)N[C@@H](C)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CO)C(=O)N1CCC[C@H]1C(=O)O |
| Chemical_Modification | X7=aminohexanoic acid |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1988.08 |
|---|---|
| Aliphatic_Index | 5.88235 |
| Aromaticity | 0.17647 |
| Average_Rotatable_Bonds | 3.29412 |
| Charge_at_pH_7 | -5.99886 |
| Isoelectric_Point | 3.09224 |
|---|---|
| Hydrogen_Bond_Acceptors | 28 |
| Hydrogen_Bond_Donors | 24 |
| Topological_Polar_Surface_Area | 782.60000 |
| X_logP_energy | -6.02320 |
Interaction Information
| Affinity | Ki=7 mM |
|---|---|
| Affinity_Assay | Radioligand binding assay |
| PDB_ID | 1ILP |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Discrete steps in binding and signaling of interleukin-8 with its receptor |
| Release_Year | 1996 |
| PMID | 8940121 |
| DOI | 10.1074/jbc.271.49.31202 |