PPIRE16153
Target Protein Information
| Protein_Name | C-C motif chemokine 2 |
|---|---|
| Protein_Sequence | MKVSAALLCLLLIAATFIPQGLAQPDAINAPVTCCYNFTNRKISVQRLASYRRITSSKCPKEAVIFKTIVAKEICADPKQKWVQDSMDHLDKQTQTPKT |
| Organism_Source | Homo sapiens |
| Functional_Classification | CC chemokines |
| Cellular_Localization | Extracellular |
| Gene_Names | CCL2 |
| UniProt_ID | P13500 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | Peptide #1 |
|---|---|
| Peptide_Sequence | HSWRHFHTLGGG |
| Peptide_Length | 12 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)[C@@H](NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CO)NC(=O)[C@@H](N)Cc1c[nH]cn1)[C@@H](C)O)C(=O)NCC(=O)NCC(=O)NCC(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1391.51 |
|---|---|
| Aliphatic_Index | 32.50000 |
| Aromaticity | 0.16667 |
| Average_Rotatable_Bonds | 3.41667 |
| Charge_at_pH_7 | 1.27071 |
| Isoelectric_Point | 10.55523 |
|---|---|
| Hydrogen_Bond_Acceptors | 19 |
| Hydrogen_Bond_Donors | 22 |
| Topological_Polar_Surface_Area | 587.61000 |
| X_logP_energy | -5.82813 |
Interaction Information
| Affinity | KD=22 uM |
|---|---|
| Affinity_Assay | Surface Plasmon Resonance |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Inhibition of the angiogenesis by the MCP-1 (monocyte chemoattractant protein-1) binding peptide |
| Release_Year | 2005 |
| PMID | 15757647 |
| DOI | 10.1016/j.febslet.2005.01.070 |