PPIRE16299
Target Protein Information
| Protein_Name | None |
|---|---|
| Protein_Sequence | MKHLKTFYKKWFQLLVVIVISFFSGALGSFSITQLTQKSSVNNSNSNSTITQTAYKNENSTTQAVNKVKDAVVSVITYSANRQNSVFGNDDTDTDSQRISSEGSGVIYKKNDKEAYIVTNNHVINGASKVDIRLSDGTKVPGEIVGADTFSDIAVVKISSEKVTTVAEFGDSSKLTVGETAIAIGSPLGSEYANTVTQGIVSSLNRNVSLKSEDGQAISTKAIQTDTAINPGNSGGPLINIQGQVIGITSSKIATNGGTSVEGLGFAIPANDAINIIEQLEKNGKVTRPALGIQMVNLSNVSTSDIRRLNIPSNVTSGVIVRSVQSNMPANGHLEKYDVITKVDDKEIASSTDLQSALYNHSIGDTIKITYYRNGKEETTSIKLNKSSGDLES |
| Organism_Source | Streptococcus pneumoniae |
| Functional_Classification | serine proteases |
| Cellular_Localization | Extracellular |
| Gene_Names | htrA |
| UniProt_ID | A0A4J2AIC8 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | KRVYYF |
|---|---|
| Peptide_Sequence | KRVYYF |
| Peptide_Length | 6 |
| Peptide_SMILES | CC(C)[C@H](NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](N)CCCCN)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 875.04 |
|---|---|
| Aliphatic_Index | 48.33333 |
| Aromaticity | 0.50000 |
| Average_Rotatable_Bonds | 4.33333 |
| Charge_at_pH_7 | 1.99599 |
| Isoelectric_Point | 10.00862 |
|---|---|
| Hydrogen_Bond_Acceptors | 11 |
| Hydrogen_Bond_Donors | 13 |
| Topological_Polar_Surface_Area | 337.20000 |
| X_logP_energy | 0.00987 |
Interaction Information
| Affinity | KD=11 uM |
|---|---|
| Affinity_Assay | Surface Plasmon Resonance |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Solution structure of HtrA PDZ domain from Streptococcus pneumoniae and its interaction with YYFOOH containing peptides |
| Release_Year | 2011 |
| PMID | 21757011 |
| DOI | 10.1016/j.jsb.2011.06.009 |