PPIRE16495
Target Protein Information
| Protein_Name | Transcriptional enhancer factor TEF-5 |
|---|---|
| Protein_Sequence | MASNSWNASSSPGEAREDGPEGLDKGLDNDAEGVWSPDIEQSFQEALAIYPPCGRRKIILSDEGKMYGRNELIARYIKLRTGKTRTRKQVSSHIQVLARKKVREYQVGIKAMNLDQVSKDKALQSMASMSSAQIVSASVLQNKFSPPSPLPQAVFSTSSRFWSSPPLLGQQPGPSQDIKPFAQPAYPIQPPLPPTLSSYEPLAPLPSAAASVPVWQDRTIASSRLRLLEYSAFMEVQRDPDTYSKHLFVHIGQTNPAFSDPPLEAVDVRQIYDKFPEKKGGLKELYEKGPPNAFFLVKFWADLNSTIQEGPGAFYGVSSQYSSADSMTISVSTKVCSFGKQVVEKVETEYARLENGRFVYRIHRSPMCEYMINFIHKLKHLPEKYMMNSVLENFTILQVVTSRDSQETLLVIAFVFEVSTSEHGAQHHVYKLVKD |
| Organism_Source | Homo sapiens |
| Functional_Classification | TEA domain family |
| Cellular_Localization | Nucleus |
| Gene_Names | TEAD3 |
| UniProt_ID | Q99594 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | YAP u-loop peptide (cyclized) |
|---|---|
| Peptide_Sequence | MRLRKLPDSFFK |
| Peptide_Length | 12 |
| Peptide_SMILES | CSCC[C@H](N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCCN)C(=O)O |
| Chemical_Modification | Disulfide bridge formation between introduced cysteines |
| Cyclization_Method | Side chainide chain cyclization; disulfide bond |
| Linear/Cyclic | Cyclic |
| N-terminal_Modification | rhodamine |
| C-terminal_Modification | Amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1537.89 |
|---|---|
| Aliphatic_Index | 65.00000 |
| Aromaticity | 0.16667 |
| Average_Rotatable_Bonds | 4.33333 |
| Charge_at_pH_7 | 2.99783 |
| Isoelectric_Point | 11.65089 |
|---|---|
| Hydrogen_Bond_Acceptors | 20 |
| Hydrogen_Bond_Donors | 22 |
| Topological_Polar_Surface_Area | 608.00000 |
| X_logP_energy | -3.18046 |
Interaction Information
| Affinity | KD=16 uM |
|---|---|
| Affinity_Assay | Fluorescence Polarization |
| PDB_ID | None |
| Type | Antagonist |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Structure-based Derivation and Optimization of YAP-like Coactivator-derived Peptides to Selectively Target TEAD Family Transcription Factors by Hydrocarbon Stapling and Cyclization |
| Release_Year | 2018 |
| PMID | 33283479 |
| DOI | 10.1111/CBDD.13813 |