PPIRE16553
Target Protein Information
| Protein_Name | HSPA8-interacting micropeptide miPEP155 |
|---|---|
| Protein_Sequence | MEMALMVAQTRKGKSVV |
| Organism_Source | Homo sapiens |
| Functional_Classification | ATPases |
| Cellular_Localization | Cytoplasm |
| Gene_Names | MIR155HG |
| UniProt_ID | C0HMA1 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | Peptide15 |
|---|---|
| Peptide_Sequence | KTLEEGGTFAEFIKASSDSLS |
| Peptide_Length | 21 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](C)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](NC(=O)CNC(=O)CNC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)[C@@H](N)CCCCN)[C@@H](C)O)[C@@H](C)O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(=O)N[C@@H](CO)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 2217.41 |
|---|---|
| Aliphatic_Index | 65.23810 |
| Aromaticity | 0.09524 |
| Average_Rotatable_Bonds | 3.61905 |
| Charge_at_pH_7 | -1.99683 |
| Isoelectric_Point | 4.14755 |
|---|---|
| Hydrogen_Bond_Acceptors | 34 |
| Hydrogen_Bond_Donors | 34 |
| Topological_Polar_Surface_Area | 967.94000 |
| X_logP_energy | -11.92150 |
Interaction Information
| Affinity | EC50=25 uM |
|---|---|
| Affinity_Assay | Colorimetric binding assay |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Short peptides derived from the BAG-1 C-terminus inhibit the interaction between BAG-1 and HSC70 and decrease breast cancer cell growth |
| Release_Year | 2009 |
| PMID | 19800331 |
| DOI | 10.1016/j.febslet.2009.09.047 |