PPIRE16911
Target Protein Information
| Protein_Name | Sex peptide receptor |
|---|---|
| Protein_Sequence | MDNYTDVLYQYRLAPSASPEMEMELADPRQMVRGFHLPTNESQLEIPDYGNESLDYPNYQQMVGGPCRMEDNNISYWNLTCDSPLEYAMPLYGYCMPFLLIITIISNSLIVLVLSKKSMATPTNFVLMGMAICDMLTVIFPAPGLWYMYTFGNHYKPLHPVSMCLAYSIFNEIMPAMCHTISVWLTLALAVQRYIYVCHAPMARTWCTMPRVRRCTAYIALLAFLHQLPRFFDRTYMPLVIEWNGSPTEVCHLETSMWVHDYIGVDLYYTSYYLFRVLFVHLLPCIILVTLNILLFAAMRQAQERRKLLFRENRKKECKKLRETNCTTLMLIVVVSVFLLAEIPIAVVTAMHIVSSLIIEFLDYGLANICIMLTNFFLVFSYPINFGIYCGMSRQFRETFKEIFLGRLMAKKDSSTKYSIVNGARTCTNTNETVL |
| Organism_Source | Drosophila melanogaster |
| Functional_Classification | G protein-coupled receptor |
| Cellular_Localization | Plasma membrane |
| Gene_Names | SPR |
| UniProt_ID | Q8SWR3 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | MIP5 |
|---|---|
| Peptide_Sequence | pQAQGWNKFRGAWa |
| Peptide_Length | 14 |
| Peptide_SMILES | C[C@H](NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](C)NC(=O)CNC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)CNC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](C)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H]1CCCN1)C(=O)O |
| Chemical_Modification | pQ1=pyroglutamic acid |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | pyroglutamic acid |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1616.80 |
|---|---|
| Aliphatic_Index | 21.42857 |
| Aromaticity | 0.21429 |
| Average_Rotatable_Bonds | 3.50000 |
| Charge_at_pH_7 | 1.99769 |
| Isoelectric_Point | 11.65178 |
|---|---|
| Hydrogen_Bond_Acceptors | 20 |
| Hydrogen_Bond_Donors | 24 |
| Topological_Polar_Surface_Area | 676.40000 |
| X_logP_energy | -6.06273 |
Interaction Information
| Affinity | EC50=10.8 nM |
|---|---|
| Affinity_Assay | aequorin-based calcium mobilization assay |
| PDB_ID | None |
| Type | Agonist |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Sex peptides and MIPs can activate the same G protein-coupled receptor |
| Release_Year | 2013 |
| PMID | 23453963 |
| DOI | 10.1016/j.ygcen.2013.02.014 |