PPIRE16946
Target Protein Information
| Protein_Name | Protein PA-X |
|---|---|
| Protein_Sequence | MEDFVRQCFNPMIVELAEKAMKEYGEDLKIETNKFAAICTHLEVCFMYSDFHFINEQGESIVVELDDPNALLKHRFEIIEGRDRTMAWTVVNSICNTTGAEKPKFLPDLYDYKENRFIEIGVTRREVHIYYLEKANKIKSENTHIHIFSFTGEEMATKADYTLDEESRARIKTRLFTIRQEMANRGLWDSFVSPKEAKKQLKKDLKSQGQCAGLPTKVSRRTSPALRILEPMWMDSNRTATLRASFLKCPKK |
| Organism_Source | Influenza A virus (strain A/Northern Territory/60/1968 H3N2) |
| Functional_Classification | polymerases |
| Cellular_Localization | Nucleus |
| Gene_Names | PA |
| UniProt_ID | P0DJT7 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | PB11-15D2N |
|---|---|
| Peptide_Sequence | MNVNPTLLFLKVPAQ |
| Peptide_Length | 15 |
| Peptide_SMILES | CSCC[C@H](N)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@H](C(=O)N[C@@H](CC(N)=O)C(=O)N1CCC[C@H]1C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)N[C@@H](C)C(=O)N[C@@H](CCC(N)=O)C(=O)O)C(C)C)[C@@H](C)O)C(C)C |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1685.06 |
|---|---|
| Aliphatic_Index | 123.33333 |
| Aromaticity | 0.06667 |
| Average_Rotatable_Bonds | 3.46667 |
| Charge_at_pH_7 | 0.99769 |
| Isoelectric_Point | 9.70000 |
|---|---|
| Hydrogen_Bond_Acceptors | 22 |
| Hydrogen_Bond_Donors | 19 |
| Topological_Polar_Surface_Area | 628.66000 |
| X_logP_energy | -3.81000 |
Interaction Information
| Affinity | IC50=45.2 nM |
|---|---|
| Affinity_Assay | ELISA |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Identification of High-Affinity PB1-Derived Peptides with Enhanced Affinity to the PA Protein of Influenza A Virus Polymerase |
| Release_Year | 2011 |
| PMID | 21135188 |
| DOI | 10.1128/AAC.01419-10 |