PPIRE17055
Target Protein Information
| Protein_Name | HLA class II histocompatibility antigen DR alpha chain |
|---|---|
| Protein_Sequence | MAISGVPVLGFFIIAVLMSAQESWAIKEEHVIIQAEFYLNPDQSGEFMFDFDGDEIFHVDMAKKETVWRLEEFGRFASFEAQGALANIAVDKANLEIMTKRSNYTPITNVPPEVTVLTNSPVELREPNVLICFIDKFTPPVVNVTWLRNGKPVTTGVSETVFLPREDHLFRKFHYLPFLPSTEDVYDCRVEHWGLDEPLLKHWEFDAPSPLPETTENVVCALGLTVGLVGIIIGTIFIIKGLRKSNAAERRGPL |
| Organism_Source | Homo sapiens |
| Functional_Classification | major histocompatibility complex class 2 |
| Cellular_Localization | Plasma membrane |
| Gene_Names | HLA-DRA |
| UniProt_ID | P01903 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | N62A |
|---|---|
| Peptide_Sequence | VTELGRPDAEWASQKDL |
| Peptide_Length | 17 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CO)NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCNC(=N)N)NC(=O)CNC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](NC(=O)[C@@H](N)C(C)C)[C@@H](C)O)C(=O)O |
| Chemical_Modification | |
| Cyclization_Method | |
| Linear/Cyclic | Linear |
| N-terminal_Modification | biotin |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1915.09 |
|---|---|
| Aliphatic_Index | 74.70588 |
| Aromaticity | 0.05882 |
| Average_Rotatable_Bonds | 3.64706 |
| Charge_at_pH_7 | -1.99787 |
| Isoelectric_Point | 4.10524 |
|---|---|
| Hydrogen_Bond_Acceptors | 27 |
| Hydrogen_Bond_Donors | 29 |
| Topological_Polar_Surface_Area | 856.59000 |
| X_logP_energy | -8.48543 |
Interaction Information
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Induced Fit of an Epitope Peptide to a Monoclonal Antibody Probed with a Novel Parallel Surface Plasmon Resonance Assay |
| Release_Year | 2004 |
| PMID | 15556932 |
| DOI | 10.1074/jbc.M410687200 |