PPIRE17096
Target Protein Information
| Protein_Name | Secretin receptor |
|---|---|
| Protein_Sequence | MLSTMRPRLSLLLLRLLLLTKAAHTVGVPPRLCDVRRVLLEERAHCLQQLSKEKKGALGPETASGCEGLWDNMSCWPSSAPARTVEVQCPKFLLMLSNKNGSLFRNCTQDGWSETFPRPDLACGVNINNSFNERRHAYLLKLKVMYTVGYSSSLAMLLVALSILCSFRRLHCTRNYIHMHLFVSFILRALSNFIKDAVLFSSDDVTYCDAHKVGCKLVMIFFQYCIMANYAWLLVEGLYLHTLLAISFFSERKYLQAFVLLGWGSPAIFVALWAITRHFLENTGCWDINANASVWWVIRGPVILSILINFIFFINILRILMRKLRTQETRGSETNHYKRLAKSTLLLIPLFGIHYIVFAFSPEDAMEVQLFFELALGSFQGLVVAVLYCFLNGEVQLEVQKKWRQWHLQEFPLRPVAFNNSFSNATNGPTHSTKASTEQSRSIPRASII |
| Organism_Source | Rattus norvegicus |
| Functional_Classification | Family B G protein coupled receptors |
| Cellular_Localization | Plasma membrane |
| Gene_Names | Sctr |
| UniProt_ID | P23811 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | secretin-Gly28-(Cys29-Alexa) |
|---|---|
| Peptide_Sequence | HSDGTFTSDSSGALQDLSLQVGDFISAGC |
| Peptide_Length | 29 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(=O)O)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](C)NC(=O)CNC(=O)[C@H](CO)NC(=O)[C@H](CO)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CO)NC(=O)[C@@H](N)Cc1c[nH]cn1)[C@@H](C)O)[C@@H](C)O)C(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)NCC(=O)N[C@@H](CS)C(=O)O |
| Chemical_Modification | C29=Alexa Fluor 488 |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 2916.08 |
|---|---|
| Aliphatic_Index | 70.68966 |
| Aromaticity | 0.06897 |
| Average_Rotatable_Bonds | 3.27586 |
| Charge_at_pH_7 | -3.97130 |
| Isoelectric_Point | 3.66111 |
|---|---|
| Hydrogen_Bond_Acceptors | 46 |
| Hydrogen_Bond_Donors | 46 |
| Topological_Polar_Surface_Area | 1304.02000 |
| X_logP_energy | -20.09530 |
Interaction Information
| Affinity | Ki=7.6 nM |
|---|---|
| Affinity_Assay | Radioligand binding assay |
| PDB_ID | None |
| Type | Agonist |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Use of Probes with Fluorescence Indicator Distributed throughout the Pharmacophore to Examine the Peptide Agonist-binding Environment of the Family B G Protein-coupled Secretin Receptor |
| Release_Year | 2006 |
| PMID | 16319066 |
| DOI | 10.1074/jbc.M509197200 |