PPIRE17188
Target Protein Information
| Protein_Name | Insulin |
|---|---|
| Protein_Sequence | MALWTRLRPLLALLALWPPPPARAFVNQHLCGSHLVEALYLVCGERGFFYTPKARREVEGPQVGALELAGGPGAGGLEGPPQKRGIVEQCCASVCSLYQLENYCN |
| Organism_Source | Bos taurus |
| Functional_Classification | Peptide hormones |
| Cellular_Localization | Extracellular |
| Gene_Names | INS |
| UniProt_ID | P01317 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | N-term-DITT-RYNGKVWWR |
|---|---|
| Peptide_Sequence | DITTRYNGKVWWR |
| Peptide_Length | 13 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@@H](N)CC(=O)O)C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CC(N)=O)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](CCCNC(=N)N)C(=O)O)C(C)C)[C@@H](C)O)[C@@H](C)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Acetyl |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1694.91 |
|---|---|
| Aliphatic_Index | 52.30769 |
| Aromaticity | 0.23077 |
| Average_Rotatable_Bonds | 4.00000 |
| Charge_at_pH_7 | 1.99728 |
| Isoelectric_Point | 10.44646 |
|---|---|
| Hydrogen_Bond_Acceptors | 22 |
| Hydrogen_Bond_Donors | 28 |
| Topological_Polar_Surface_Area | 735.00000 |
| X_logP_energy | -5.28706 |
Interaction Information
| Affinity | KD=24.04 uM |
|---|---|
| Affinity_Assay | Isothermal Titration Calorimetry |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | De Novo designed 13 mer hairpin-peptide arrests insulin and inhibits its aggregation: role of OH interactions between water and hydrophobic amino acids |
| Release_Year | 2020 |
| PMID | 35497136 |
| DOI | 10.1039/d0ra00832j |