PPIRE17295
Target Protein Information
| Protein_Name | Casein kinase II subunit alpha |
|---|---|
| Protein_Sequence | MSGPVPSRARVYTDVNTHRPREYWDYESHVVEWGNQDDYQLVRKLGRGKYSEVFEAINITNNEKVVVKILKPVKKKKIKREIKILENLRGGPNIITLADIVKDPVSRTPALVFEHVNNTDFKQLYQTLTDYDIRFYMYEILKALDYCHSMGIMHRDVKPHNVMIDHEHRKLRLIDWGLAEFYHPGQEYNVRVASRYFKGPELLVDYQMYDYSLDMWSLGCMLASMIFRKEPFFHGHDNYDQLVRIAKVLGTEDLYDYIDKYNIELDPRFNDILGRHSRKRWERFVHSENQHLVSPEALDFLDKLLRYDHQSRLTAREAMEHPYFYTVVKDQARMGSSSMPGGSTPVSSANMMSGISSVPTPSPLGPLAGSPVIAAANPLGMPVPAAAGAQQ |
| Organism_Source | Homo sapiens |
| Functional_Classification | protein kinases |
| Cellular_Localization | Nucleus |
| Gene_Names | CSNK2A1 |
| UniProt_ID | P68400 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | KESEEE-NH2 |
|---|---|
| Peptide_Sequence | KESEEE |
| Peptide_Length | 6 |
| Peptide_SMILES | NCCCC[C@H](N)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 749.73 |
|---|---|
| Aliphatic_Index | 0.00000 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 4.66667 |
| Charge_at_pH_7 | -2.99521 |
| Isoelectric_Point | 3.81972 |
|---|---|
| Hydrogen_Bond_Acceptors | 13 |
| Hydrogen_Bond_Donors | 13 |
| Topological_Polar_Surface_Area | 404.27000 |
| X_logP_energy | -4.59720 |
Interaction Information
| Affinity | KD=0.36 mM |
|---|---|
| Affinity_Assay | Microscale Thermophoresis |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Rational drug-design approach supported with thermodynamic studies a peptide leader for the efficient bi-substrate inhibitor of protein kinase CK2 |
| Release_Year | 2019 |
| PMID | 31358826 |
| DOI | 10.1038/s41598-019-47404-0 |