PPIRE17508
Target Protein Information
| Protein_Name | Sex peptide receptor |
|---|---|
| Protein_Sequence | MDNYTDVLYQYRLAPSASPEMEMELADPRQMVRGFHLPTNESQLEIPDYGNESLDYPNYQQMVGGPCRMEDNNISYWNLTCDSPLEYAMPLYGYCMPFLLIITIISNSLIVLVLSKKSMATPTNFVLMGMAICDMLTVIFPAPGLWYMYTFGNHYKPLHPVSMCLAYSIFNEIMPAMCHTISVWLTLALAVQRYIYVCHAPMARTWCTMPRVRRCTAYIALLAFLHQLPRFFDRTYMPLVIEWNGSPTEVCHLETSMWVHDYIGVDLYYTSYYLFRVLFVHLLPCIILVTLNILLFAAMRQAQERRKLLFRENRKKECKKLRETNCTTLMLIVVVSVFLLAEIPIAVVTAMHIVSSLIIEFLDYGLANICIMLTNFFLVFSYPINFGIYCGMSRQFRETFKEIFLGRLMAKKDSSTKYSIVNGARTCTNTNETVL |
| Organism_Source | Drosophila melanogaster |
| Functional_Classification | G protein-coupled receptor |
| Cellular_Localization | Plasma membrane |
| Gene_Names | SPR |
| UniProt_ID | Q8SWR3 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | MIP3 |
|---|---|
| Peptide_Sequence | EPTWNNLKGMWa |
| Peptide_Length | 12 |
| Peptide_SMILES | CSCC[C@H](NC(=O)CNC(=O)[C@H](CCCCN)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@@H](NC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)CCC(=O)O)[C@@H](C)O)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](C)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1446.64 |
|---|---|
| Aliphatic_Index | 40.83333 |
| Aromaticity | 0.16667 |
| Average_Rotatable_Bonds | 3.58333 |
| Charge_at_pH_7 | -0.00054 |
| Isoelectric_Point | 6.40880 |
|---|---|
| Hydrogen_Bond_Acceptors | 19 |
| Hydrogen_Bond_Donors | 19 |
| Topological_Polar_Surface_Area | 575.94000 |
| X_logP_energy | -3.73880 |
Interaction Information
| Affinity | EC50=24.9 nM |
|---|---|
| Affinity_Assay | aequorin assay |
| PDB_ID | None |
| Type | Agonist |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Myoinhibiting peptides are the ancestral ligands of the promiscuous Drosophila sex peptide receptor |
| Release_Year | 2010 |
| PMID | 20458515 |
| DOI | 10.1007/s00018-010-0393-8 |