PPIRE17619
Target Protein Information
| Protein_Name | Insulin |
|---|---|
| Protein_Sequence | MALWTRLRPLLALLALWPPPPARAFVNQHLCGSHLVEALYLVCGERGFFYTPKARREVEGPQVGALELAGGPGAGGLEGPPQKRGIVEQCCASVCSLYQLENYCN |
| Organism_Source | Bos taurus |
| Functional_Classification | peptide hormones |
| Cellular_Localization | Extracellular |
| Gene_Names | INS |
| UniProt_ID | P01317 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | anti-PNInB antibodyPS19R10 |
|---|---|
| Peptide_Sequence | KRAFIASRRIRRP |
| Peptide_Length | 13 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](C)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](N)CCCCN)C(=O)N[C@@H](C)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@H](C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)O)[C@@H](C)CC |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1626.97 |
|---|---|
| Aliphatic_Index | 75.38462 |
| Aromaticity | 0.07692 |
| Average_Rotatable_Bonds | 4.23077 |
| Charge_at_pH_7 | 5.99767 |
| Isoelectric_Point | 13.10476 |
|---|---|
| Hydrogen_Bond_Acceptors | 21 |
| Hydrogen_Bond_Donors | 30 |
| Topological_Polar_Surface_Area | 759.48000 |
| X_logP_energy | -7.46555 |
Interaction Information
| Affinity | KD=0.5 uM |
|---|---|
| Affinity_Assay | Surface Plasmon Resonance |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Development of a one-step ELISA method using an affinity peptide tag specific to a hydrophilic polystyrene surface |
| Release_Year | 2007 |
| PMID | 16950537 |
| DOI | 10.1016/j.jbiotec.2006.07.011 |