PPIRE17738
Target Protein Information
| Protein_Name | Calcium and integrin-binding protein 1 |
|---|---|
| Protein_Sequence | MGGSGSRLSKELLAEYQDLTFLTKQEILLAHRRFCELLPQEQRSVESSLRAQVPFEQILSLPELKANPFKERICRVFSTSPAKDSLSFEDFLDLLSVFSDTATPDIKSHYAFRIFDFDDDGTLNREDLSRLVNCLTGEGEDTRLSASEMKQLIDNILEESDIDRDGTINLSEFQHVISRSPDFASSFKIVL |
| Organism_Source | Homo sapiens |
| Functional_Classification | EF hand proteins |
| Cellular_Localization | Cytoplasm |
| Gene_Names | CIB1 |
| UniProt_ID | Q99828 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | UNC10245121 |
|---|---|
| Peptide_Sequence | FWYGAMKALYG |
| Peptide_Length | 11 |
| Peptide_SMILES | CSCC[C@H](NC(=O)[C@H](C)NC(=O)CNC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@@H](N)Cc1ccccc1)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)NCC(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | Side chain-side chain cyclization; G4<-->K7; amide bond |
| Linear/Cyclic | Cyclic |
| N-terminal_Modification | Free |
| C-terminal_Modification | Amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1306.54 |
|---|---|
| Aliphatic_Index | 53.63636 |
| Aromaticity | 0.36364 |
| Average_Rotatable_Bonds | 3.45455 |
| Charge_at_pH_7 | 0.99599 |
| Isoelectric_Point | 9.14560 |
|---|---|
| Hydrogen_Bond_Acceptors | 16 |
| Hydrogen_Bond_Donors | 16 |
| Topological_Polar_Surface_Area | 436.59000 |
| X_logP_energy | 0.34040 |
Interaction Information
| Affinity | IC50=32 nM |
|---|---|
| Affinity_Assay | fluorescence resonance energy transfer |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Discovery and Characterization of Peptide Inhibitors for CIB1 |
| Release_Year | 2020 |
| PMID | 32383857 |
| DOI | 10.1021/acschembio.0c00144 |