PPIRE17769
Target Protein Information
| Protein_Name | CD2 antigen cytoplasmic tail-binding protein 2 |
|---|---|
| Protein_Sequence | MPKRKVTFQGVGDEEDEDEIIVPKKKLVDPVAGSGGPGSRFKGKHSLDSDEEEDDDDGGSSKYDILASEDVEGQEAATLPSEGGVRITPFNLQEEMEEGHFDADGNYFLNRDAQIRDSWLDNIDWVKIRERPPGQRQASDSEEEDSLGQTSMSAQALLEGLLELLLPRETVAGALRRLGARGGGKGRKGPGQPSSPQRLDRLSGLADQMVARGNLGVYQETRERLAMRLKGLGCQTLGPHNPTPPPSLDMFAEELAEEELETPTPTQRGEAESRGDGLVDVMWEYKWENTGDAELYGPFTSAQMQTWVSEGYFPDGVYCRKLDPPGGQFYNSKRIDFDLYT |
| Organism_Source | Homo sapiens |
| Functional_Classification | GYF domains |
| Cellular_Localization | Nucleus |
| Gene_Names | CD2BP2 |
| UniProt_ID | O95400 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | 20h |
|---|---|
| Peptide_Sequence | PPGWLGR |
| Peptide_Length | 7 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)CNC(=O)[C@@H]1CCCN1C(=O)[C@@H]1CCCN1)C(=O)NCC(=O)N[C@@H](CCCNC(=N)N)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | fluorescein |
| C-terminal_Modification | Amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 781.91 |
|---|---|
| Aliphatic_Index | 55.71429 |
| Aromaticity | 0.14286 |
| Average_Rotatable_Bonds | 2.85714 |
| Charge_at_pH_7 | 0.99798 |
| Isoelectric_Point | 10.55000 |
|---|---|
| Hydrogen_Bond_Acceptors | 9 |
| Hydrogen_Bond_Donors | 11 |
| Topological_Polar_Surface_Area | 292.83000 |
| X_logP_energy | -1.46583 |
Interaction Information
| Affinity | KD=295 uM |
|---|---|
| Affinity_Assay | Fluorescence Polarization |
| PDB_ID | 1GYF |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Resin-Bound Aminofluorescein for C-Terminal Labeling of Peptides: High-Affinity Polarization Probes Binding to Polyproline-Specific GYF Domains |
| Release_Year | 2008 |
| PMID | 18803191 |
| DOI | 10.1002/cbic.200800329 |